5-Ethynyl-1-(4-thio-beta-D-ribofuranosyl)imidazole-4-carbonitrile

ID: ALA4469088

PubChem CID: 155533827

Max Phase: Preclinical

Molecular Formula: C11H11N3O3S

Molecular Weight: 265.29

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C#Cc1c(C#N)ncn1[C@@H]1S[C@H](CO)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C11H11N3O3S/c1-2-7-6(3-12)13-5-14(7)11-10(17)9(16)8(4-15)18-11/h1,5,8-11,15-17H,4H2/t8-,9-,10-,11-/m1/s1

Standard InChI Key:  KSNDQRPLZJBFFS-GWOFURMSSA-N

Molfile:  

 
     RDKit          2D

 18 19  0  0  0  0  0  0  0  0999 V2000
   29.2744   -3.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0916   -3.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3460   -3.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6830   -2.5960    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   29.0243   -3.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5712   -4.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.7932   -4.5154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.2469   -2.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0767   -2.0267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.1235   -2.8267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7836   -3.3083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4454   -2.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1939   -2.0513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3767   -2.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7822   -4.1255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7834   -4.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2198   -3.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9966   -3.3359    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  2  6  1  6
  1  7  1  6
  5  8  1  1
  8  9  1  0
  3 10  1  1
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 11 15  1  0
 15 16  3  0
 17 18  3  0
 12 17  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4469088

    ---

Associated Targets(non-human)

dengue virus type 1 (258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BHK-21 (725 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 265.29Molecular Weight (Monoisotopic): 265.0521AlogP: -0.94#Rotatable Bonds: 2
Polar Surface Area: 102.30Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.94CX Basic pKa: 0.71CX LogP: -1.08CX LogD: -1.08
Aromatic Rings: 1Heavy Atoms: 18QED Weighted: 0.60Np Likeness Score: -0.19

References

1. Okano Y, Saito-Tarashima N, Kurosawa M, Iwabu A, Ota M, Watanabe T, Kato F, Hishiki T, Fujimuro M, Minakawa N..  (2019)  Synthesis and biological evaluation of novel imidazole nucleosides as potential anti-dengue virus agents.,  27  (11): [PMID:31003866] [10.1016/j.bmc.2019.04.015]
2. Nascimento IJDS, Santos-Júnior PFDS, Aquino TM, Araújo-Júnior JX, Silva-Júnior EFD..  (2021)  Insights on Dengue and Zika NS5 RNA-dependent RNA polymerase (RdRp) inhibitors.,  224  [PMID:34274831] [10.1016/j.ejmech.2021.113698]

Source