The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(7-(2-((1,4-dioxan-2-yl)methoxy)phenyl)thieno[2,3-d]pyridazin-4-ylamino)-3-fluorophenyl)acetamide ID: ALA4469586
PubChem CID: 142487477
Max Phase: Preclinical
Molecular Formula: C25H23FN4O4S
Molecular Weight: 494.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)Cc1ccc(Nc2nnc(-c3ccccc3OCC3COCCO3)c3sccc23)c(F)c1
Standard InChI: InChI=1S/C25H23FN4O4S/c26-19-11-15(12-22(27)31)5-6-20(19)28-25-18-7-10-35-24(18)23(29-30-25)17-3-1-2-4-21(17)34-14-16-13-32-8-9-33-16/h1-7,10-11,16H,8-9,12-14H2,(H2,27,31)(H,28,30)
Standard InChI Key: NZPBVZAPPICUKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
38.4988 -8.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6755 -5.7973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3852 -5.3879 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3823 -4.5652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6737 -4.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9674 -5.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9687 -4.5718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1925 -4.3183 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.7115 -4.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1905 -5.6394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6685 -3.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3760 -2.9368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3726 -2.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6625 -1.7142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9543 -2.1305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9612 -2.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6753 -6.6145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.3829 -7.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3786 -7.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0853 -8.2474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7941 -7.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7917 -7.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0844 -6.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2095 -7.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9177 -8.2452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.2087 -7.0202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.6696 -8.2452 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.0852 -3.3428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.7914 -2.9317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5006 -3.3378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4996 -4.1572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2047 -4.5632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.9133 -4.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9124 -3.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2028 -2.9269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 7 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
5 11 1 0
2 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 1 1 0
1 24 1 0
24 25 1 0
24 26 2 0
19 27 1 0
12 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.55Molecular Weight (Monoisotopic): 494.1424AlogP: 4.06#Rotatable Bonds: 8Polar Surface Area: 108.59Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.93CX Basic pKa: 0.83CX LogP: 3.33CX LogD: 3.33Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.49
References 1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y.. (2019) Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators., 29 (14): [PMID:31101471 ] [10.1016/j.bmcl.2019.05.013 ]