2-(4-(7-(2-((1,4-dioxan-2-yl)methoxy)phenyl)thieno[2,3-d]pyridazin-4-ylamino)-3-fluorophenyl)acetamide

ID: ALA4469586

PubChem CID: 142487477

Max Phase: Preclinical

Molecular Formula: C25H23FN4O4S

Molecular Weight: 494.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=O)Cc1ccc(Nc2nnc(-c3ccccc3OCC3COCCO3)c3sccc23)c(F)c1

Standard InChI:  InChI=1S/C25H23FN4O4S/c26-19-11-15(12-22(27)31)5-6-20(19)28-25-18-7-10-35-24(18)23(29-30-25)17-3-1-2-4-21(17)34-14-16-13-32-8-9-33-16/h1-7,10-11,16H,8-9,12-14H2,(H2,27,31)(H,28,30)

Standard InChI Key:  NZPBVZAPPICUKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   38.4988   -8.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6755   -5.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3852   -5.3879    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3823   -4.5652    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.6737   -4.1599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9674   -5.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9687   -4.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1925   -4.3183    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   33.7115   -4.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1905   -5.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6685   -3.3480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3760   -2.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3726   -2.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6625   -1.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9543   -2.1305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9612   -2.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6753   -6.6145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3829   -7.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3786   -7.8387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0853   -8.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7941   -7.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7917   -7.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0844   -6.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2095   -7.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9177   -8.2452    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2087   -7.0202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6696   -8.2452    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.0852   -3.3428    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.7914   -2.9317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5006   -3.3378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4996   -4.1572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2047   -4.5632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.9133   -4.1555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9124   -3.3374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2028   -2.9269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  6  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  7  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10  6  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  5 11  1  0
  2 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21  1  1  0
  1 24  1  0
 24 25  1  0
 24 26  2  0
 19 27  1  0
 12 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4469586

    ---

Associated Targets(non-human)

Slc2a4 Solute carrier family 2, facilitated glucose transporter member 4 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.55Molecular Weight (Monoisotopic): 494.1424AlogP: 4.06#Rotatable Bonds: 8
Polar Surface Area: 108.59Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.93CX Basic pKa: 0.83CX LogP: 3.33CX LogD: 3.33
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.49

References

1. Tsuji T, Yamaguchi M, Kuroyanagi J, Furuzono S, Konishi M, Terayama K, Tanaka J, Saito M, Kobayashi Y..  (2019)  Discovery of novel pyridazine derivatives as glucose transporter type 4 (GLUT4) translocation activators.,  29  (14): [PMID:31101471] [10.1016/j.bmcl.2019.05.013]

Source