Benzyl ((2S)-1-(((3S)-1-(benzylamino)-2-hydroxy-5-methyl-1-oxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate

ID: ALA4469724

PubChem CID: 155533978

Max Phase: Preclinical

Molecular Formula: C28H39N3O5

Molecular Weight: 497.64

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(O)C(=O)NCc1ccccc1

Standard InChI:  InChI=1S/C28H39N3O5/c1-19(2)15-23(25(32)27(34)29-17-21-11-7-5-8-12-21)30-26(33)24(16-20(3)4)31-28(35)36-18-22-13-9-6-10-14-22/h5-14,19-20,23-25,32H,15-18H2,1-4H3,(H,29,34)(H,30,33)(H,31,35)/t23-,24-,25?/m0/s1

Standard InChI Key:  IJBAPUBJJRGFEI-JWDFLIAJSA-N

Molfile:  

 
     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
   17.3126   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0270   -3.0917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.5981   -3.0917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3126   -4.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5981   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8836   -1.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8867   -1.0281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1730   -0.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4575   -1.0282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4603   -1.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1744   -2.2662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7407   -3.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4561   -3.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7941   -4.3411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1705   -3.5042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4561   -2.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8848   -3.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5995   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3139   -3.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0284   -3.5042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3139   -2.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7429   -3.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4573   -3.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4557   -4.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1694   -4.7427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8848   -4.3301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8821   -3.5009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1680   -3.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5382   -4.6805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6170   -5.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2100   -4.2015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5995   -4.3292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2435   -2.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7794   -1.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1381   -0.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9566   -1.7282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  2 12  1  0
 12 13  1  0
 12 14  1  6
 13 15  1  0
 13 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 29  1  0
 29 30  1  0
 29 31  1  0
 18 32  1  0
 17 33  1  1
 33 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4469724

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 497.64

Molecular Weight (Monoisotopic): 497.2890

AlogP: 3.54

#Rotatable Bonds: 13

Polar Surface Area: 116.76

Molecular Species: NEUTRAL

HBA: 5

HBD: 4

#RO5 Violations: ┄

HBA (Lipinski): 8

HBD (Lipinski): 4

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: 12.49

CX Basic pKa: ┄

CX LogP: 4.07

CX LogD: 4.07

Aromatic Rings: 2

Heavy Atoms: 36

QED Weighted: 0.34

Np Likeness Score: -0.19

References

1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M..  (2019)  Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors.,  10  (7): [PMID:31312413] [10.1021/acsmedchemlett.9b00233]

Source

Source(1):

• Scientific Literature