The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4S,11bS)-9,10-bis(benzyloxy)-4-(4-nitrophenyl)-3,4,6,7-tetrahydro-1H-pyrido[2,1-a]isoquinolin-2(11bH)-one ID: ALA4470022
PubChem CID: 155534110
Max Phase: Preclinical
Molecular Formula: C33H30N2O5
Molecular Weight: 534.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C[C@@H](c2ccc([N+](=O)[O-])cc2)N2CCc3cc(OCc4ccccc4)c(OCc4ccccc4)cc3[C@@H]2C1
Standard InChI: InChI=1S/C33H30N2O5/c36-28-18-30(25-11-13-27(14-12-25)35(37)38)34-16-15-26-17-32(39-21-23-7-3-1-4-8-23)33(20-29(26)31(34)19-28)40-22-24-9-5-2-6-10-24/h1-14,17,20,30-31H,15-16,18-19,21-22H2/t30-,31-/m0/s1
Standard InChI Key: RRGLWVAFILDCLV-CONSDPRKSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
10.1386 -11.0880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5511 -10.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1386 -9.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5511 -8.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7261 -8.9445 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.1386 -8.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3135 -8.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9010 -7.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0760 -7.5156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6635 -6.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8385 -6.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4260 -7.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6009 -7.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1884 -6.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6009 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4260 -6.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3135 -6.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9010 -6.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3135 -5.3721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9010 -4.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0760 -4.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6635 -3.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0760 -3.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9010 -3.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3135 -3.9431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1386 -6.8010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5511 -7.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3761 -7.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7886 -8.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3761 -8.9445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7886 -9.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3761 -10.3735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6092 -9.6591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0148 -10.3707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8346 -10.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2457 -9.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8310 -8.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0125 -8.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0692 -9.6589 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4786 -8.9476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4805 -10.3689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 6
4 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
11 16 1 0
8 17 2 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
20 25 1 0
17 26 1 0
26 27 2 0
6 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
4 30 1 0
30 31 1 0
31 32 1 0
2 32 1 0
31 33 1 6
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
39 40 2 0
39 41 1 0
36 39 1 0
M CHG 2 39 1 41 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.61Molecular Weight (Monoisotopic): 534.2155AlogP: 6.76#Rotatable Bonds: 8Polar Surface Area: 81.91Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.88CX LogP: 6.86CX LogD: 6.84Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -0.07
References 1. Zheng H, Dong Y, Li L, Sun B, Liu L, Yuan H, Lou H.. (2016) Novel Benzo[a]quinolizidine Analogs Induce Cancer Cell Death through Paraptosis and Apoptosis., 59 (10): [PMID:27077446 ] [10.1021/acs.jmedchem.6b00484 ]