The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Acetamidobenzyl)-N-(4-(dimethylcarbamoyl)phenyl)-2,4-dihydroxybenzamide ID: ALA4470078
PubChem CID: 155534260
Max Phase: Preclinical
Molecular Formula: C25H25N3O5
Molecular Weight: 447.49
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(CN(C(=O)c2ccc(O)cc2O)c2ccc(C(=O)N(C)C)cc2)cc1
Standard InChI: InChI=1S/C25H25N3O5/c1-16(29)26-19-8-4-17(5-9-19)15-28(25(33)22-13-12-21(30)14-23(22)31)20-10-6-18(7-11-20)24(32)27(2)3/h4-14,30-31H,15H2,1-3H3,(H,26,29)
Standard InChI Key: VCQLZAWRWBAQKG-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
15.6078 -15.5514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6066 -16.3709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3147 -16.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0243 -16.3704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0215 -15.5478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3129 -15.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9000 -15.1429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3145 -17.5971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7327 -16.7779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7340 -17.5951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4397 -16.3682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1481 -16.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8552 -16.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5622 -16.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2688 -16.3658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2679 -15.5477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5546 -15.1404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8510 -15.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9745 -15.1371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6834 -15.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3899 -15.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6857 -16.3608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4385 -15.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1457 -15.1469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1447 -14.3304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4358 -13.9221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7264 -14.3362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7309 -15.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4335 -13.1049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1400 -12.6943 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7246 -12.6984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8489 -13.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1376 -11.8771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
3 8 1 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
11 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 1 0
29 31 2 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.49Molecular Weight (Monoisotopic): 447.1794AlogP: 3.61#Rotatable Bonds: 6Polar Surface Area: 110.18Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.83CX Basic pKa: ┄CX LogP: 2.58CX LogD: 2.44Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -1.19
References 1. Cho H, Shin I, Cho K, Yoon H, Yoon H, Yoo EK, Kim MJ, Park S, Lee IK, Kim ND, Sim T.. (2019) Identification of Novel Resorcinol Amide Derivatives as Potent and Specific Pyruvate Dehydrogenase Kinase (PDHK) Inhibitors., 62 (18): [PMID:31469962 ] [10.1021/acs.jmedchem.9b00565 ] 2. Morrell, J A JA and 5 more authors. 2003-12 AZD7545 is a selective inhibitor of pyruvate dehydrogenase kinase 2. [PMID:14641019 ] 3. Moore, Jonathan D and 12 more authors. 2014-12-30 VER-246608, a novel pan-isoform ATP competitive inhibitor of pyruvate dehydrogenase kinase, disrupts Warburg metabolism and induces context-dependent cytostasis in cancer cells. [PMID:25404640 ] 4. Tso, Shih-Chia and 9 more authors. 2017-02-09 Development of Dihydroxyphenyl Sulfonylisoindoline Derivatives as Liver-Targeting Pyruvate Dehydrogenase Kinase Inhibitors. [PMID:28085286 ]