The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-[3-(3,4-Dichlorophenyl)ureido]phenyl]-4-methoxybenzenesulfonamide ID: ALA4470225
PubChem CID: 117722686
Max Phase: Preclinical
Molecular Formula: C20H17Cl2N3O4S
Molecular Weight: 466.35
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)Nc2ccccc2NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1
Standard InChI: InChI=1S/C20H17Cl2N3O4S/c1-29-14-7-9-15(10-8-14)30(27,28)25-19-5-3-2-4-18(19)24-20(26)23-13-6-11-16(21)17(22)12-13/h2-12,25H,1H3,(H2,23,24,26)
Standard InChI Key: KTECLDDPOWTCNQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
4.4409 -12.6087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0364 -11.9029 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6275 -12.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3278 -11.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7432 -11.4951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4524 -11.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3260 -10.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6181 -10.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9142 -10.6964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9226 -11.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6310 -11.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2031 -10.2937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4524 -12.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1608 -13.1229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8679 -12.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8622 -11.8902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1532 -11.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1465 -10.6709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8508 -10.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5619 -10.6592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8441 -9.4393 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2662 -10.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9763 -10.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6801 -10.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6738 -9.4176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9578 -9.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2569 -9.4311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9481 -8.1979 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.3776 -9.0023 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.1963 -9.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 1 0
4 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 4 1 0
9 12 1 0
6 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 6 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
26 28 1 0
25 29 1 0
12 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.35Molecular Weight (Monoisotopic): 465.0317AlogP: 5.45#Rotatable Bonds: 6Polar Surface Area: 96.53Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.50CX Basic pKa: ┄CX LogP: 5.31CX LogD: 5.09Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: -1.84
References 1. (2014) Serine racemase inhibitor,