The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(2-((2-methoxy-4-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)phenyl)amino)pyridin-4-yl)-N-(4-(trifluoromethoxy)benzyl)piperidine-3-carboxamide ID: ALA4470301
PubChem CID: 155534287
Max Phase: Preclinical
Molecular Formula: C36H46F3N7O3
Molecular Weight: 681.80
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1cc(N2CCC[C@H](C(=O)NCc3ccc(OC(F)(F)F)cc3)C2)ccn1
Standard InChI: InChI=1S/C36H46F3N7O3/c1-43-18-20-45(21-19-43)28-12-16-44(17-13-28)29-7-10-32(33(22-29)48-2)42-34-23-30(11-14-40-34)46-15-3-4-27(25-46)35(47)41-24-26-5-8-31(9-6-26)49-36(37,38)39/h5-11,14,22-23,27-28H,3-4,12-13,15-21,24-25H2,1-2H3,(H,40,42)(H,41,47)/t27-/m0/s1
Standard InChI Key: YUFYDDHGCLTQIH-MHZLTWQESA-N
Molfile:
RDKit 2D
49 54 0 0 0 0 0 0 0 0999 V2000
9.8723 -3.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8723 -4.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5817 -4.4946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2911 -4.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2911 -3.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5817 -2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5813 -5.3150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8678 -5.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8675 -6.5436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5799 -6.9571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2940 -6.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2909 -5.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0042 -2.8581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7148 -3.2688 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.0066 -2.0368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4278 -2.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1385 -3.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1347 -4.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8404 -4.5100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5544 -4.0993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5542 -3.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8438 -2.8668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1555 -6.9560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4472 -6.5483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4476 -5.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7402 -5.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0320 -5.7347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0358 -6.5561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7438 -6.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2618 -4.5084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2613 -5.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9687 -5.7346 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.5533 -5.7337 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.2572 -6.1413 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.3232 -5.3280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3234 -4.5140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6186 -4.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9096 -4.5144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9098 -5.3326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6191 -5.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2023 -4.1051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2016 -3.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4984 -2.8760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7879 -3.2803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7850 -4.0984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4927 -4.5122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0821 -2.8682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7483 -7.7771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0429 -8.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 7 1 0
5 13 1 6
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
9 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
20 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
27 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
38 41 1 0
41 42 1 0
41 46 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
44 47 1 0
29 48 1 0
48 49 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 681.80Molecular Weight (Monoisotopic): 681.3614AlogP: 5.48#Rotatable Bonds: 10Polar Surface Area: 85.44Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.35CX LogP: 5.52CX LogD: 2.99Aromatic Rings: 3Heavy Atoms: 49QED Weighted: 0.29Np Likeness Score: -1.44
References 1. Liu S, Jiang Y, Yan R, Li Z, Wan S, Zhang T, Wu X, Hou J, Zhu Z, Tian Y, Zhang J.. (2019) Design, synthesis and biological evaluations of 2-amino-4-(1-piperidine) pyridine derivatives as novel anti crizotinib-resistant ALK/ROS1 dual inhibitors., 179 [PMID:31260890 ] [10.1016/j.ejmech.2019.06.043 ]