1-but-3-ynoyl-3,5-bis[(4-fluoro-3-nitrophenyl)methylene]azepan-4-one

ID: ALA4470335

PubChem CID: 155534324

Max Phase: Preclinical

Molecular Formula: C24H17F2N3O6

Molecular Weight: 481.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C#CCC(=O)N1CC/C(=C\c2ccc(F)c([N+](=O)[O-])c2)C(=O)/C(=C/c2ccc(F)c([N+](=O)[O-])c2)C1

Standard InChI:  InChI=1S/C24H17F2N3O6/c1-2-3-23(30)27-9-8-17(10-15-4-6-19(25)21(12-15)28(32)33)24(31)18(14-27)11-16-5-7-20(26)22(13-16)29(34)35/h1,4-7,10-13H,3,8-9,14H2/b17-10+,18-11+

Standard InChI Key:  YZXJGQIHLWQTES-ODPUSEOTSA-N

Molfile:  

 
     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   18.8020  -12.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5395  -11.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2739  -12.2718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6111  -13.0487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4506  -13.0684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1151  -13.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9333  -13.6995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5490  -11.0920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.9169  -11.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6752  -12.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1693  -11.7350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4051  -12.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7889  -12.8825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5464  -13.1872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1903  -12.6826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0718  -11.8698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3143  -11.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7749  -11.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0113  -11.7937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8791  -12.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5167  -13.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2779  -12.8274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3778  -11.2759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.6134  -11.5648    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5098  -10.4694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.7137  -11.3608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5955  -10.5521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.4730  -11.6627    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1152  -12.8913    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   23.9490  -12.9863    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.2803  -14.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8130  -15.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1600  -15.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0945  -14.5088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.5069  -16.5864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  3  5  1  0
  4  6  1  0
  5  7  1  0
  6  7  1  0
  2  8  2  0
  3  9  2  0
  9 10  1  0
  1 11  2  0
 11 12  1  0
 10 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 10  1  0
 12 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 12  1  0
 23 24  2  0
 23 25  1  0
 19 23  1  0
 26 27  2  0
 26 28  1  0
 16 26  1  0
 20 29  1  0
 15 30  1  0
  7 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  2  0
 33 35  3  0
M  CHG  4  23   1  25  -1  26   1  28  -1
M  END

Alternative Forms

  1. Parent:

    ALA4470335

    ---

Associated Targets(Human)

KMS-11 (183 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
U2OS (164939 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 481.41Molecular Weight (Monoisotopic): 481.1085AlogP: 4.07#Rotatable Bonds: 5
Polar Surface Area: 123.66Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.30CX LogD: 4.30
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.95

References

1. Ward JA, Pinto-Fernandez A, Cornelissen L, Bonham S, Díaz-Sáez L, Riant O, Huber KVM, Kessler BM, Feron O, Tate EW..  (2020)  Re-Evaluating the Mechanism of Action of α,β-Unsaturated Carbonyl DUB Inhibitors b-AP15 and VLX1570: A Paradigmatic Example of Unspecific Protein Cross-linking with Michael Acceptor Motif-Containing Drugs.,  63  (7): [PMID:32109059] [10.1021/acs.jmedchem.0c00144]

Source