The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-but-3-ynoyl-3,5-bis[(4-fluoro-3-nitrophenyl)methylene]azepan-4-one ID: ALA4470335
PubChem CID: 155534324
Max Phase: Preclinical
Molecular Formula: C24H17F2N3O6
Molecular Weight: 481.41
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCC(=O)N1CC/C(=C\c2ccc(F)c([N+](=O)[O-])c2)C(=O)/C(=C/c2ccc(F)c([N+](=O)[O-])c2)C1
Standard InChI: InChI=1S/C24H17F2N3O6/c1-2-3-23(30)27-9-8-17(10-15-4-6-19(25)21(12-15)28(32)33)24(31)18(14-27)11-16-5-7-20(26)22(13-16)29(34)35/h1,4-7,10-13H,3,8-9,14H2/b17-10+,18-11+
Standard InChI Key: YZXJGQIHLWQTES-ODPUSEOTSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
18.8020 -12.2522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5395 -11.9091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2739 -12.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6111 -13.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4506 -13.0684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1151 -13.6937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9333 -13.6995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5490 -11.0920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9169 -11.7674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6752 -12.0721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1693 -11.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4051 -12.0243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7889 -12.8825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5464 -13.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1903 -12.6826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0718 -11.8698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3143 -11.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7749 -11.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0113 -11.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8791 -12.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5167 -13.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2779 -12.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3778 -11.2759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6134 -11.5648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5098 -10.4694 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7137 -11.3608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.5955 -10.5521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.4730 -11.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1152 -12.8913 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.9490 -12.9863 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.2803 -14.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8130 -15.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1600 -15.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0945 -14.5088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.5069 -16.5864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 1 0
3 5 1 0
4 6 1 0
5 7 1 0
6 7 1 0
2 8 2 0
3 9 2 0
9 10 1 0
1 11 2 0
11 12 1 0
10 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 10 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
23 24 2 0
23 25 1 0
19 23 1 0
26 27 2 0
26 28 1 0
16 26 1 0
20 29 1 0
15 30 1 0
7 31 1 0
31 32 1 0
32 33 1 0
31 34 2 0
33 35 3 0
M CHG 4 23 1 25 -1 26 1 28 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.41Molecular Weight (Monoisotopic): 481.1085AlogP: 4.07#Rotatable Bonds: 5Polar Surface Area: 123.66Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.30CX LogD: 4.30Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.27Np Likeness Score: -0.95
References 1. Ward JA, Pinto-Fernandez A, Cornelissen L, Bonham S, Díaz-Sáez L, Riant O, Huber KVM, Kessler BM, Feron O, Tate EW.. (2020) Re-Evaluating the Mechanism of Action of α,β-Unsaturated Carbonyl DUB Inhibitors b-AP15 and VLX1570: A Paradigmatic Example of Unspecific Protein Cross-linking with Michael Acceptor Motif-Containing Drugs., 63 (7): [PMID:32109059 ] [10.1021/acs.jmedchem.0c00144 ]