The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-chloro-4-((2-(isopropylsulfonyl)phenyl)amino)pyrimidin-2-yl)amino)-3-methoxyphenyl)-3-(2(dimethylamino)ethyl)imidazolidin-2-one ID: ALA4470529
PubChem CID: 155534552
Max Phase: Preclinical
Molecular Formula: C27H34ClN7O4S
Molecular Weight: 588.13
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCN(CCN(C)C)C2=O)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C27H34ClN7O4S/c1-18(2)40(37,38)24-9-7-6-8-22(24)30-25-20(28)17-29-26(32-25)31-21-11-10-19(16-23(21)39-5)35-15-14-34(27(35)36)13-12-33(3)4/h6-11,16-18H,12-15H2,1-5H3,(H2,29,30,31,32)
Standard InChI Key: SSPYHBZSDDTSFN-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
13.8964 -24.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0792 -24.8542 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.4878 -25.5619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3761 -22.8112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3750 -23.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0830 -24.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7927 -23.6302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7899 -22.8076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0813 -22.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5011 -24.0377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3750 -25.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3790 -26.0825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6654 -24.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2081 -23.6280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9131 -24.0359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.6197 -23.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6189 -22.8088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9056 -22.4015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2019 -22.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4915 -22.4089 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.3279 -24.0347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0351 -23.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7423 -24.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4491 -23.6261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4486 -22.8081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7355 -22.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0317 -22.8114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7421 -24.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0342 -25.2604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4447 -21.1737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1534 -21.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1591 -22.3954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9358 -22.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4102 -21.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9266 -21.3235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1737 -20.5445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9718 -20.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2189 -19.5901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0164 -19.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6653 -18.9916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
6 2 1 0
7 10 1 0
2 11 1 0
11 12 1 0
11 13 1 0
10 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
19 20 1 0
16 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
23 28 1 0
28 29 1 0
25 32 1 0
31 30 2 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 588.13Molecular Weight (Monoisotopic): 587.2082AlogP: 4.61#Rotatable Bonds: 11Polar Surface Area: 120.00Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.55CX Basic pKa: 8.46CX LogP: 3.63CX LogD: 2.53Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -1.82
References 1. Lei H, Jiang N, Miao X, Xing L, Guo M, Liu Y, Xu H, Gong P, Zuo D, Zhai X.. (2019) Discovery of novel mutant-combating ALK and ROS1 dual inhibitors bearing imidazolidin-2-one moiety with reasonable PK properties., 171 [PMID:30927566 ] [10.1016/j.ejmech.2019.03.038 ]