methyl 4-hydroxy-3-(3'-methyl-1'-oxo-2'-butenyl)benzoate

ID: ALA447071

PubChem CID: 11701427

Max Phase: Preclinical

Molecular Formula: C13H14O4

Molecular Weight: 234.25

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: methyl taboganate | methyl taboganate|CHEMBL447071

Canonical SMILES:  COC(=O)c1ccc(O)c(C(=O)C=C(C)C)c1

Standard InChI:  InChI=1S/C13H14O4/c1-8(2)6-12(15)10-7-9(13(16)17-3)4-5-11(10)14/h4-7,14H,1-3H3

Standard InChI Key:  MYNYNZOFYYKQDQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 17 17  0  0  0  0  0  0  0  0999 V2000
    5.3882  -12.1314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3869  -12.9590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0998  -13.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8191  -12.9584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8159  -12.1274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0979  -11.7187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0985  -14.1994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3835  -14.6107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8123  -14.6130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0939  -10.8937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6697  -14.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5283  -11.7114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2449  -12.1204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5243  -10.8865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9572  -11.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6737  -12.1132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9531  -10.8794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  9  2  0
  3  7  1  0
  4  5  1  0
  6 10  1  0
  2  3  1  0
  8 11  1  0
  5  6  2  0
  5 12  1  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 12 14  2  0
  3  4  2  0
 13 15  2  0
 15 16  1  0
  7  8  1  0
 15 17  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(non-human)

Cladosporium cladosporioides (101 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cladosporium sphaerospermum (47 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 234.25Molecular Weight (Monoisotopic): 234.0892AlogP: 2.33#Rotatable Bonds: 3
Polar Surface Area: 63.60Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 6.23CX Basic pKa: CX LogP: 3.27CX LogD: 2.12
Aromatic Rings: 1Heavy Atoms: 17QED Weighted: 0.49Np Likeness Score: 0.70

References

1. Lago JH, Ramos CS, Casanova DC, Morandim Ade A, Bergamo DC, Cavalheiro AJ, Bolzani Vda S, Furlan M, Guimarães EF, Young MC, Kato MJ..  (2004)  Benzoic acid derivatives from Piper species and their fungitoxic activity against Cladosporium cladosporioides and C. sphaerospermum.,  67  (11): [PMID:15568762] [10.1021/np030530j]

Source