The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2'-Deoxyzebularine 5'-[Naphthyl(benzoxydimethylglycinyl)]-phosphate ID: ALA447089
PubChem CID: 25155586
Max Phase: Preclinical
Molecular Formula: C30H32N3O8P
Molecular Weight: 593.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(NP(=O)(OC[C@H]1O[C@@H](n2cccnc2=O)C[C@@H]1O)Oc1cccc2ccccc12)C(=O)OCc1ccccc1
Standard InChI: InChI=1S/C30H32N3O8P/c1-30(2,28(35)38-19-21-10-4-3-5-11-21)32-42(37,41-25-15-8-13-22-12-6-7-14-23(22)25)39-20-26-24(34)18-27(40-26)33-17-9-16-31-29(33)36/h3-17,24,26-27,34H,18-20H2,1-2H3,(H,32,37)/t24-,26+,27+,42?/m0/s1
Standard InChI Key: ABUSJRLHCNTYJH-ZFFCALLGSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
12.2626 -12.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0613 -12.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5047 -11.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9799 -10.8864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2123 -11.1887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6259 -12.5369 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3282 -11.4728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7812 -12.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6012 -12.1197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9733 -11.3830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5192 -10.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6929 -10.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4096 -12.9043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5165 -10.7454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5526 -9.9212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8569 -9.4779 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
10.1367 -9.0667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2831 -8.7716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4342 -10.1865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4242 -9.4825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0029 -10.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7244 -10.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4335 -10.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1064 -8.7865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9314 -8.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3476 -9.4935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3405 -8.0646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9995 -9.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7122 -9.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7111 -8.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9981 -7.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2846 -8.2599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2892 -9.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1655 -8.0600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5740 -7.3432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1009 -9.6116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1101 -7.9615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3995 -7.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8079 -6.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3914 -5.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5621 -5.9186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1575 -6.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 29 2 0
1 2 1 0
28 21 2 0
7 12 1 0
21 22 1 0
8 9 1 0
22 23 2 0
23 20 1 0
9 10 2 0
18 24 1 0
10 11 1 0
24 25 1 0
11 12 2 0
1 6 1 6
25 26 2 0
25 27 1 0
8 13 2 0
28 29 1 0
5 14 1 1
29 30 1 0
3 7 1 1
30 31 2 0
14 15 1 0
31 32 1 0
7 8 1 0
32 33 2 0
33 28 1 0
15 16 1 0
27 34 1 0
2 3 1 0
34 35 1 0
16 17 1 0
24 36 1 0
3 4 1 0
24 37 1 0
16 18 1 0
35 38 2 0
4 5 1 0
38 39 1 0
16 19 2 0
39 40 2 0
5 1 1 0
40 41 1 0
17 20 1 0
41 42 2 0
42 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.57Molecular Weight (Monoisotopic): 593.1927AlogP: 4.36#Rotatable Bonds: 11Polar Surface Area: 138.21Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.17CX Basic pKa: ┄CX LogP: 3.59CX LogD: 3.59Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: 0.01
References 1. Yoo CB, Valente R, Congiatu C, Gavazza F, Angel A, Siddiqui MA, Jones PA, McGuigan C, Marquez VE.. (2008) Activation of p16 gene silenced by DNA methylation in cancer cells by phosphoramidate derivatives of 2'-deoxyzebularine., 51 (23): [PMID:19006382 ] [10.1021/jm8005965 ]