The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-((4'-((6,7-Dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)-methyl)biphenyl-4-yl)oxy)propoxy)-1,2,5-oxadiazol-3-carbonitrile ID: ALA4470909
PubChem CID: 155534635
Max Phase: Preclinical
Molecular Formula: C30H30N4O5
Molecular Weight: 526.59
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(Cc1ccc(-c3ccc(OCCCOc4nonc4C#N)cc3)cc1)CC2
Standard InChI: InChI=1S/C30H30N4O5/c1-35-28-16-24-12-13-34(20-25(24)17-29(28)36-2)19-21-4-6-22(7-5-21)23-8-10-26(11-9-23)37-14-3-15-38-30-27(18-31)32-39-33-30/h4-11,16-17H,3,12-15,19-20H2,1-2H3
Standard InChI Key: UZVOEPRLGDNYHN-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
20.4655 -3.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4644 -4.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1724 -4.7242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1706 -3.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8792 -3.4921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8826 -4.3173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5950 -4.7247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3086 -4.3115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3052 -3.4863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5882 -3.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0174 -4.7181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7240 -4.3076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4289 -4.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1350 -4.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1332 -3.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4194 -3.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7162 -3.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8358 -3.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5454 -3.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2510 -3.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2481 -2.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5338 -1.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8312 -2.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9536 -1.8437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6635 -2.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3690 -1.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0789 -2.2409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7844 -1.8285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.4943 -2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5800 -3.0452 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.3803 -3.2108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7851 -2.5009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.2349 -1.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7563 -4.7233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0489 -4.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7577 -3.0873 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0501 -3.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4008 -1.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5654 -0.2982 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 18 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
2 34 1 0
34 35 1 0
1 36 1 0
36 37 1 0
38 39 3 0
33 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.59Molecular Weight (Monoisotopic): 526.2216AlogP: 5.03#Rotatable Bonds: 11Polar Surface Area: 102.87Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.70CX LogP: 4.98CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -0.99
References 1. Guglielmo S, Lazzarato L, Contino M, Perrone MG, Chegaev K, Carrieri A, Fruttero R, Colabufo NA, Gasco A.. (2016) Structure-Activity Relationship Studies on Tetrahydroisoquinoline Derivatives: [4'-(6,7-Dimethoxy-3,4-dihydro-1H-isoquinolin-2-ylmethyl)biphenyl-4-ol] (MC70) Conjugated through Flexible Alkyl Chains with Furazan Moieties Gives Rise to Potent and Selective Ligands of P-glycoprotein., 59 (14): [PMID:27336199 ] [10.1021/acs.jmedchem.6b00252 ]