The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
14-O-(((4-(2-(4-(dimethylamino)piperidin-1-yl)acetamido)-1H-pyrrolo[2,3-d]pyrimidin-6-yl)thio)acetyl)mutilin ID: ALA4471131
PubChem CID: 155534960
Max Phase: Preclinical
Molecular Formula: C37H54N6O5S
Molecular Weight: 694.94
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C[C@]1(C)C[C@@H](OC(=O)CSc2nc(NC(=O)CN3CCC(N(C)C)CC3)c3cc[nH]c3n2)[C@]2(C)[C@H](C)CC[C@]3(CCC(=O)[C@H]32)[C@@H](C)[C@@H]1O
Standard InChI: InChI=1S/C37H54N6O5S/c1-8-35(4)19-27(36(5)22(2)9-14-37(23(3)31(35)47)15-10-26(44)30(36)37)48-29(46)21-49-34-40-32-25(11-16-38-32)33(41-34)39-28(45)20-43-17-12-24(13-18-43)42(6)7/h8,11,16,22-24,27,30-31,47H,1,9-10,12-15,17-21H2,2-7H3,(H2,38,39,40,41,45)/t22-,23+,27-,30+,31+,35-,36+,37+/m1/s1
Standard InChI Key: VKNDFGUUXCPJJQ-AIEHSFANSA-N
Molfile:
RDKit 2D
50 55 0 0 0 0 0 0 0 0999 V2000
43.9214 -5.6001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9255 -6.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6380 -6.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1130 -6.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5018 -6.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5018 -7.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9255 -8.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1130 -8.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5369 -7.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5369 -6.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2672 -9.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8297 -8.2084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6006 -8.3210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8006 -9.0585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.1047 -9.1251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.4714 -9.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0839 -9.4668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1131 -7.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8172 -7.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8172 -6.5834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.8156 -5.7584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1004 -5.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5293 -5.3446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3867 -5.7611 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.6714 -5.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.6338 -5.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.2634 -6.6800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.2639 -8.1253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3255 -7.5835 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
39.6726 -4.5280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9582 -4.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9628 -5.7675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2478 -5.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2417 -4.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4482 -4.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9638 -4.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4581 -5.6231 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.9589 -3.2920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2447 -2.8790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2452 -2.0540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5298 -3.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8156 -2.8779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8212 -2.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1112 -1.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3940 -2.0461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3913 -2.8720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1060 -3.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6813 -1.6304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.6850 -0.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9650 -2.0396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
4 2 1 0
2 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 4 1 0
7 11 1 1
9 12 1 0
12 13 1 0
13 11 1 0
8 14 1 0
7 15 1 0
14 16 1 0
15 16 1 0
14 17 2 0
12 18 1 1
9 19 1 6
10 20 1 6
20 21 1 0
21 22 1 0
21 23 2 0
22 24 1 0
24 25 1 0
1 26 2 0
5 27 1 1
6 28 1 6
8 29 1 6
25 30 2 0
30 31 1 0
31 34 2 0
33 32 2 0
32 25 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 33 1 0
31 38 1 0
38 39 1 0
39 40 2 0
39 41 1 0
41 42 1 0
42 43 1 0
42 47 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
45 48 1 0
48 49 1 0
48 50 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 694.94Molecular Weight (Monoisotopic): 694.3876AlogP: 4.92#Rotatable Bonds: 9Polar Surface Area: 140.75Molecular Species: BASEHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.47CX Basic pKa: 9.67CX LogP: 4.03CX LogD: 2.03Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.14Np Likeness Score: 0.25
References 1. Deng Y, Wang XZ, Huang SH, Li CH.. (2019) Antibacterial activity evaluation of synthetic novel pleuromutilin derivatives in vitro and in experimental infection mice., 162 [PMID:30445267 ] [10.1016/j.ejmech.2018.11.006 ]