The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(tert-Butyl)-1-phenyl-1H-pyrazol-5-yl)-3-(4-(8-(cyclopropylamino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)-3-methylphenyl)urea ID: ALA4471413
PubChem CID: 142727716
Max Phase: Preclinical
Molecular Formula: C29H31N9O
Molecular Weight: 521.63
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(NC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2)ccc1-c1cnc(NC2CC2)c2ncnn12
Standard InChI: InChI=1S/C29H31N9O/c1-18-14-20(12-13-22(18)23-16-30-26(33-19-10-11-19)27-31-17-32-38(23)27)34-28(39)35-25-15-24(29(2,3)4)36-37(25)21-8-6-5-7-9-21/h5-9,12-17,19H,10-11H2,1-4H3,(H,30,33)(H2,34,35,39)
Standard InChI Key: NIBGMNSTTXRNEY-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
2.9757 -12.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6810 -13.2278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3904 -12.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3904 -12.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9734 -11.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6810 -11.5851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5109 -10.7817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6939 -10.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3619 -11.4473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0998 -11.5934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8107 -12.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5233 -11.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5261 -10.7777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8105 -10.3672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1009 -10.7754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2651 -13.2339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2674 -14.0552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2386 -10.3703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9498 -10.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6623 -10.3725 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9485 -11.6013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3693 -10.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4596 -11.5984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.2628 -11.7696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6726 -11.0584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1226 -10.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0428 -12.3074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2208 -12.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8081 -13.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2122 -13.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0374 -13.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4505 -13.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8594 -14.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6807 -14.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3891 -10.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4902 -11.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9043 -11.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9016 -10.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3115 -11.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
4 10 1 0
1 16 1 0
16 17 1 0
13 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 2 0
23 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 17 1 0
34 33 1 0
17 34 1 0
15 35 1 0
25 36 1 0
36 37 1 0
36 38 1 0
36 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.63Molecular Weight (Monoisotopic): 521.2652AlogP: 5.80#Rotatable Bonds: 6Polar Surface Area: 114.06Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.30CX Basic pKa: 1.90CX LogP: 5.81CX LogD: 5.81Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.92
References 1. Kang SJ, Lee JW, Chung SH, Jang SY, Choi J, Suh KH, Kim YH, Ham YJ, Min KH.. (2019) Synthesis and anti-tumor activity of imidazopyrazines as TAK1 inhibitors., 163 [PMID:30576901 ] [10.1016/j.ejmech.2018.12.025 ]