1-(3-(tert-Butyl)-1-phenyl-1H-pyrazol-5-yl)-3-(4-(8-(cyclopropylamino)-[1,2,4]triazolo[1,5-a]pyrazin-5-yl)-3-methylphenyl)urea

ID: ALA4471413

PubChem CID: 142727716

Max Phase: Preclinical

Molecular Formula: C29H31N9O

Molecular Weight: 521.63

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(NC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2)ccc1-c1cnc(NC2CC2)c2ncnn12

Standard InChI:  InChI=1S/C29H31N9O/c1-18-14-20(12-13-22(18)23-16-30-26(33-19-10-11-19)27-31-17-32-38(23)27)34-28(39)35-25-15-24(29(2,3)4)36-37(25)21-8-6-5-7-9-21/h5-9,12-17,19H,10-11H2,1-4H3,(H,30,33)(H2,34,35,39)

Standard InChI Key:  NIBGMNSTTXRNEY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    2.9757  -12.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6810  -13.2278    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3904  -12.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3904  -12.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9734  -11.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6810  -11.5851    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5109  -10.7817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6939  -10.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3619  -11.4473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0998  -11.5934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8107  -12.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5233  -11.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5261  -10.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8105  -10.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1009  -10.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2651  -13.2339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2674  -14.0552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2386  -10.3703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9498  -10.7800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6623  -10.3725    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9485  -11.6013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3693  -10.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4596  -11.5984    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2628  -11.7696    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6726  -11.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1226  -10.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0428  -12.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2208  -12.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8081  -13.0078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2122  -13.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0374  -13.7252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4505  -13.0164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8594  -14.7678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6807  -14.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3891  -10.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4902  -11.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9043  -11.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9016  -10.3484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3115  -11.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  4 10  1  0
  1 16  1  0
 16 17  1  0
 13 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  2  0
 23 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 33 17  1  0
 34 33  1  0
 17 34  1  0
 15 35  1  0
 25 36  1  0
 36 37  1  0
 36 38  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4471413

    ---

Associated Targets(Human)

MAP3K7 Tchem Mitogen-activated protein kinase kinase kinase 7 (1167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.63Molecular Weight (Monoisotopic): 521.2652AlogP: 5.80#Rotatable Bonds: 6
Polar Surface Area: 114.06Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.30CX Basic pKa: 1.90CX LogP: 5.81CX LogD: 5.81
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -1.92

References

1. Kang SJ, Lee JW, Chung SH, Jang SY, Choi J, Suh KH, Kim YH, Ham YJ, Min KH..  (2019)  Synthesis and anti-tumor activity of imidazopyrazines as TAK1 inhibitors.,  163  [PMID:30576901] [10.1016/j.ejmech.2018.12.025]

Source