The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((bis(2-chloroethyl)amino)(4-(methylthio)phenyl)methyl)-1,4-dihydroxyanthracene-9,10-dione ID: ALA4471656
PubChem CID: 155535167
Max Phase: Preclinical
Molecular Formula: C26H23Cl2NO4S
Molecular Weight: 516.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(C(c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)N(CCCl)CCCl)cc1
Standard InChI: InChI=1S/C26H23Cl2NO4S/c1-34-16-8-6-15(7-9-16)23(29(12-10-27)13-11-28)19-14-20(30)21-22(26(19)33)25(32)18-5-3-2-4-17(18)24(21)31/h2-9,14,23,30,33H,10-13H2,1H3
Standard InChI Key: GZBMMEGUWPSAKS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
5.5094 -6.3188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5094 -4.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8041 -5.9143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8066 -5.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1029 -4.6908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3961 -5.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3975 -5.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1019 -6.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2147 -5.0971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2131 -5.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9173 -6.3198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6236 -5.9128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6212 -5.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9164 -4.6907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5079 -3.8672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5106 -7.1360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9166 -7.1370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9144 -3.8735 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3276 -4.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3250 -3.8663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0331 -5.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0344 -5.9071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7425 -6.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4499 -5.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4447 -5.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7359 -4.6785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1595 -6.3079 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0314 -3.4554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6160 -3.4600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6134 -2.6428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9044 -2.2365 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.0288 -2.6382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7352 -2.2274 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.8653 -5.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4 2 1 0
3 1 1 0
1 10 1 0
9 2 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
2 15 2 0
1 16 2 0
11 17 1 0
14 18 1 0
13 19 1 0
19 20 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
19 21 1 0
24 27 1 0
20 28 1 0
20 29 1 0
29 30 1 0
30 31 1 0
28 32 1 0
32 33 1 0
27 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.45Molecular Weight (Monoisotopic): 515.0725AlogP: 5.46#Rotatable Bonds: 8Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.85CX Basic pKa: 4.06CX LogP: 7.29CX LogD: 7.16Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: 0.10
References 1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X.. (2019) Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents., 29 (9): [PMID:30846253 ] [10.1016/j.bmcl.2019.02.026 ]