2-((bis(2-chloroethyl)amino)(4-(methylthio)phenyl)methyl)-1,4-dihydroxyanthracene-9,10-dione

ID: ALA4471656

PubChem CID: 155535167

Max Phase: Preclinical

Molecular Formula: C26H23Cl2NO4S

Molecular Weight: 516.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CSc1ccc(C(c2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)N(CCCl)CCCl)cc1

Standard InChI:  InChI=1S/C26H23Cl2NO4S/c1-34-16-8-6-15(7-9-16)23(29(12-10-27)13-11-28)19-14-20(30)21-22(26(19)33)25(32)18-5-3-2-4-17(18)24(21)31/h2-9,14,23,30,33H,10-13H2,1H3

Standard InChI Key:  GZBMMEGUWPSAKS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    5.5094   -6.3188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5094   -4.6844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8041   -5.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8066   -5.0989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1029   -4.6908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3961   -5.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3975   -5.9155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1019   -6.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2147   -5.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2131   -5.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9173   -6.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6236   -5.9128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6212   -5.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9164   -4.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5079   -3.8672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5106   -7.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9166   -7.1370    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9144   -3.8735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3276   -4.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3250   -3.8663    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0331   -5.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0344   -5.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7425   -6.3134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4499   -5.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4447   -5.0811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7359   -4.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1595   -6.3079    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.0314   -3.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6160   -3.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6134   -2.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9044   -2.2365    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.0288   -2.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7352   -2.2274    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.8653   -5.8961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 10  1  0
  9  2  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  3  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  2 15  2  0
  1 16  2  0
 11 17  1  0
 14 18  1  0
 13 19  1  0
 19 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 19 21  1  0
 24 27  1  0
 20 28  1  0
 20 29  1  0
 29 30  1  0
 30 31  1  0
 28 32  1  0
 32 33  1  0
 27 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4471656

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.45Molecular Weight (Monoisotopic): 515.0725AlogP: 5.46#Rotatable Bonds: 8
Polar Surface Area: 77.84Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.85CX Basic pKa: 4.06CX LogP: 7.29CX LogD: 7.16
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: 0.10

References

1. Liu Y, Liang Y, Jiang J, Qin Q, Wang L, Liu X..  (2019)  Design, synthesis and biological evaluation of 1,4-dihydroxyanthraquinone derivatives as anticancer agents.,  29  (9): [PMID:30846253] [10.1016/j.bmcl.2019.02.026]

Source