1-benzyl-3-(1-((3,5-dimethylisoxazol-4-yl)methyl)-1H-pyrazol-4-yl)imidazolidine-2,4,5-trione

ID: ALA4471870

PubChem CID: 57944981

Max Phase: Preclinical

Molecular Formula: C19H17N5O4

Molecular Weight: 379.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1noc(C)c1Cn1cc(N2C(=O)C(=O)N(Cc3ccccc3)C2=O)cn1

Standard InChI:  InChI=1S/C19H17N5O4/c1-12-16(13(2)28-21-12)11-22-10-15(8-20-22)24-18(26)17(25)23(19(24)27)9-14-6-4-3-5-7-14/h3-8,10H,9,11H2,1-2H3

Standard InChI Key:  AHTLZRURDSTFOP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   23.6779   -4.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.4992   -4.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7536   -3.5074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0906   -3.0211    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4277   -3.5074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1967   -4.9487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5352   -3.2518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9829   -4.9499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7998   -4.8654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3450   -5.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0961   -5.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0116   -4.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2084   -4.1541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8075   -5.5554    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.8897   -6.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6927   -6.5389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1022   -5.8275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5521   -5.2184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7190   -4.4185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9148   -5.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3960   -6.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0627   -7.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5433   -7.8086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3568   -7.7224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6874   -6.9704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2048   -6.3136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2816   -6.9153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.0261   -7.2850    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  1  0
  1  6  1  0
  3  7  1  0
  2  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 14  1  0
 18 19  2  0
 17 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 15 27  2  0
 16 28  2  0
M  END

Associated Targets(Human)

TAS2R8 Tchem Taste receptor type 2 member 8 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 379.38Molecular Weight (Monoisotopic): 379.1281AlogP: 2.03#Rotatable Bonds: 5
Polar Surface Area: 101.54Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.67CX LogP: 1.47CX LogD: 1.47
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -2.00

References

1. Fotsing JR, Darmohusodo V, Patron AP, Ching BW, Brady T, Arellano M, Chen Q, Davis TJ, Liu H, Servant G, Zhang L, Williams M, Saganich M, Ditschun T, Tachdjian C, Karanewsky DS..  (2020)  Discovery and Development of S6821 and S7958 as Potent TAS2R8 Antagonists.,  63  (9): [PMID:32330040] [10.1021/acs.jmedchem.0c00388]

Source