Diacetylclinopodiolide A

ID: ALA4472157

PubChem CID: 155535787

Max Phase: Preclinical

Molecular Formula: C25H32O7

Molecular Weight: 444.52

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1c(C(C)C)cc2c(c1OC(C)=O)[C@]13CCC[C@](C)([C@H](OC(C)=O)OC1=O)[C@@H]3CC2

Standard InChI:  InChI=1S/C25H32O7/c1-13(2)17-12-16-8-9-18-24(5)10-7-11-25(18,22(28)32-23(24)31-15(4)27)19(16)21(20(17)29-6)30-14(3)26/h12-13,18,23H,7-11H2,1-6H3/t18-,23+,24-,25+/m0/s1

Standard InChI Key:  ZHKLRQDNLMPQEM-LVEBQJTPSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   20.2609   -5.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9707   -4.8228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2565   -4.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2654   -6.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6893   -5.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9707   -3.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3990   -3.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3902   -4.8272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6893   -3.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1148   -5.5898    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5513   -6.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9752   -6.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1368   -7.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6893   -6.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1176   -3.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5556   -4.8139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6893   -2.7685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8326   -6.0660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8326   -5.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1220   -2.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8318   -3.9984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3183   -6.8859    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   19.9612   -7.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4895   -3.9719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3698   -7.6221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.2590   -3.5879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.3967   -2.3607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2571   -2.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5410   -2.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9667   -2.3540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6120   -7.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8447   -7.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6169   -6.2953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  3  1  1
  4  1  1  0
  5  2  2  0
  6  2  1  0
  7  9  1  0
  8  5  1  0
  9  6  2  0
 10  3  1  0
 11  4  1  0
 12  4  1  0
 13 11  1  0
 14 12  1  0
 15  7  1  0
 16  1  1  0
 17  9  1  0
 18 19  1  0
 19 16  1  0
 20 15  1  0
 21 15  1  0
  4 22  1  6
 11 18  1  0
  5 14  1  0
 10 13  1  0
  8  7  2  0
 11 23  1  6
  3 24  2  0
 13 25  1  6
  6 26  1  0
 17 27  1  0
 26 28  1  0
 28 29  1  0
 28 30  2  0
 25 31  1  0
 31 32  1  0
 31 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4472157

    ---

Associated Targets(non-human)

Brain (4256 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.52Molecular Weight (Monoisotopic): 444.2148AlogP: 4.18#Rotatable Bonds: 4
Polar Surface Area: 88.13Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.66CX LogD: 4.66
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.51Np Likeness Score: 2.03

References

1. Bustos-Brito C, Joseph-Nathan P, Burgueño-Tapia E, Martínez-Otero D, Nieto-Camacho A, Calzada F, Yépez-Mulia L, Esquivel B, Quijano L..  (2019)  Structure and Absolute Configuration of Abietane Diterpenoids from Salvia clinopodioides: Antioxidant, Antiprotozoal, and Antipropulsive Activities.,  82  (5): [PMID:31063376] [10.1021/acs.jnatprod.8b00952]

Source