The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Clinopodiolide C ID: ALA4472179
PubChem CID: 155535490
Max Phase: Preclinical
Molecular Formula: C20H26O4
Molecular Weight: 330.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc2c(c(O)c1O)[C@]13CCC[C@](C)(COC1=O)[C@@H]3CC2
Standard InChI: InChI=1S/C20H26O4/c1-11(2)13-9-12-5-6-14-19(3)7-4-8-20(14,18(23)24-10-19)15(12)17(22)16(13)21/h9,11,14,21-22H,4-8,10H2,1-3H3/t14-,19+,20+/m0/s1
Standard InChI Key: NEJZCFPJTWECEJ-VHKYSDTDSA-N
Molfile:
RDKit 2D
25 28 0 0 0 0 0 0 0 0999 V2000
40.6697 -3.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3301 -3.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6656 -3.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6738 -4.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9946 -3.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3301 -2.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6508 -2.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6425 -3.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9946 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6090 -4.3212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0135 -5.1384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.3342 -5.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6296 -5.7988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9946 -4.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3194 -2.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0176 -3.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9946 -1.7045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3449 -4.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3449 -3.9993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3235 -1.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9797 -2.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7234 -5.5222 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
39.9557 -2.8230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6679 -2.4676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3932 -5.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 1
4 1 1 0
5 2 2 0
6 2 1 0
7 9 1 0
8 5 1 0
9 6 2 0
10 3 1 0
11 4 1 0
12 4 1 0
13 11 1 0
14 12 1 0
15 7 1 0
16 1 1 0
17 9 1 0
18 19 1 0
19 16 1 0
20 15 1 0
21 15 1 0
4 22 1 6
11 18 1 0
5 14 1 0
10 13 1 0
8 7 2 0
3 23 2 0
6 24 1 0
11 25 1 6
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 330.42Molecular Weight (Monoisotopic): 330.1831AlogP: 3.77#Rotatable Bonds: 1Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.46CX Basic pKa: ┄CX LogP: 4.53CX LogD: 4.52Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.61Np Likeness Score: 2.44
References 1. Bustos-Brito C, Joseph-Nathan P, Burgueño-Tapia E, Martínez-Otero D, Nieto-Camacho A, Calzada F, Yépez-Mulia L, Esquivel B, Quijano L.. (2019) Structure and Absolute Configuration of Abietane Diterpenoids from Salvia clinopodioides: Antioxidant, Antiprotozoal, and Antipropulsive Activities., 82 (5): [PMID:31063376 ] [10.1021/acs.jnatprod.8b00952 ]