Benwamycin B

ID: ALA4472301

PubChem CID: 155535698

Max Phase: Preclinical

Molecular Formula: C17H26O3

Molecular Weight: 278.39

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc([C@H](C)[C@@H](O)[C@H](C)[C@H](C)O)c(/C=C/CO)c1

Standard InChI:  InChI=1S/C17H26O3/c1-11-7-8-16(15(10-11)6-5-9-18)13(3)17(20)12(2)14(4)19/h5-8,10,12-14,17-20H,9H2,1-4H3/b6-5+/t12-,13+,14+,17+/m1/s1

Standard InChI Key:  XUDPSDWBKFBGHF-JOPHYIFZSA-N

Molfile:  

 
     RDKit          2D

 20 20  0  0  0  0  0  0  0  0999 V2000
    5.1010  -11.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8131  -11.4378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5173  -11.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5173  -12.6640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8115  -13.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1010  -12.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2253  -13.0758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8131  -10.6184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5212  -10.2107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5212   -9.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2292   -8.9795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3929  -11.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6848  -11.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6848  -12.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9768  -11.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2646  -11.8492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5565  -11.4374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2646  -12.6645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9768  -10.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3929  -10.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  2  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
  1 12  1  0
 12 13  1  0
 13 14  1  1
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  1
 15 19  1  1
 12 20  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4472301

    ---

Associated Targets(non-human)

3T3-L1 (3664 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 278.39Molecular Weight (Monoisotopic): 278.1882AlogP: 2.48#Rotatable Bonds: 6
Polar Surface Area: 60.69Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.54CX LogD: 2.54
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.75Np Likeness Score: 0.91

References

1. Yang FX, Huang JP, Liu Z, Wang Z, Yang J, Tang J, Yu Z, Yan Y, Kai G, Huang SX..  (2020)  Benwamycins A-G, Trialkyl-Substituted Benzene Derivatives from a Soil-Derived Streptomyces.,  83  (1): [PMID:31904958] [10.1021/acs.jnatprod.9b00903]

Source