The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Spiro[indoline-3,7'-pyrano[3,2-c:5,6-c']dichromene]-2,6',8'-trione ID: ALA4472328
PubChem CID: 15855397
Max Phase: Preclinical
Molecular Formula: C26H13NO6
Molecular Weight: 435.39
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1Nc2ccccc2C12c1c(c3ccccc3oc1=O)Oc1c2c(=O)oc2ccccc12
Standard InChI: InChI=1S/C26H13NO6/c28-23-19-21(13-7-1-5-11-17(13)31-23)33-22-14-8-2-6-12-18(14)32-24(29)20(22)26(19)15-9-3-4-10-16(15)27-25(26)30/h1-12H,(H,27,30)
Standard InChI Key: ZQVRFENUFOJJFS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 39 0 0 0 0 0 0 0 0999 V2000
12.5092 -8.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8340 -9.6503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1449 -8.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5128 -6.6890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7988 -7.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7988 -7.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3693 -7.9341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0863 -8.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2267 -7.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2232 -7.9341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9338 -8.3484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6527 -7.9401 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9409 -6.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6519 -7.1129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3680 -6.7068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3744 -5.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6587 -5.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9456 -5.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3693 -7.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0830 -6.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0846 -5.8772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3733 -5.4645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6589 -5.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6608 -6.6978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0058 -9.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8087 -8.7866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0140 -8.5559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4158 -9.1299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6174 -9.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4118 -10.1645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8289 -8.7129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3657 -8.7572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6482 -8.7613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 26 1 0
25 2 1 0
2 3 1 0
3 1 1 0
6 4 1 0
5 1 1 0
1 10 1 0
9 4 1 0
5 6 2 0
5 8 1 0
6 20 1 0
19 7 1 0
7 8 1 0
9 10 2 0
9 13 1 0
10 11 1 0
11 12 1 0
12 14 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
3 31 2 0
8 32 2 0
11 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 435.39Molecular Weight (Monoisotopic): 435.0743AlogP: 4.29#Rotatable Bonds: ┄Polar Surface Area: 98.75Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.77CX Basic pKa: ┄CX LogP: 2.42CX LogD: 2.42Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: 0.21
References 1. Parthasarathy K, Praveen C, Jeyaveeran JC, Prince AA.. (2016) Gold catalyzed double condensation reaction: Synthesis, antimicrobial and cytotoxicity of spirooxindole derivatives., 26 (17): [PMID:27476145 ] [10.1016/j.bmcl.2016.07.036 ]