The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(2-aminoethoxy)-N-(6-(2-aminoethoxy)-4'-fluorobiphenyl-3-yl)-3',4'-difluorobiphenyl-3-carboxamide dihydrochloride ID: ALA4472448
PubChem CID: 155535457
Max Phase: Preclinical
Molecular Formula: C29H28Cl2F3N3O3
Molecular Weight: 521.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.NCCOc1ccc(NC(=O)c2ccc(OCCN)c(-c3ccc(F)c(F)c3)c2)cc1-c1ccc(F)cc1
Standard InChI: InChI=1S/C29H26F3N3O3.2ClH/c30-21-5-1-18(2-6-21)24-17-22(7-10-28(24)38-14-12-34)35-29(36)20-4-9-27(37-13-11-33)23(15-20)19-3-8-25(31)26(32)16-19;;/h1-10,15-17H,11-14,33-34H2,(H,35,36);2*1H
Standard InChI Key: LNUFJJAUSXORAT-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
11.6113 -2.1943 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.1275 -4.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1264 -5.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8344 -5.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5441 -5.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5412 -4.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8326 -4.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8342 -6.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1264 -6.8867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5418 -6.8871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8302 -3.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5367 -2.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5342 -1.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2407 -1.5680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5416 -7.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8334 -8.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8328 -8.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5410 -9.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2511 -8.9216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2482 -8.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9602 -9.3279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9601 -10.1458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6684 -10.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3757 -10.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3704 -9.3196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6616 -8.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0853 -10.5463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.2474 -4.0177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9539 -4.4267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6596 -4.0161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6570 -3.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9427 -2.7923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2400 -3.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3626 -2.7858 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.5419 -10.1516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8346 -10.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8355 -11.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1282 -11.7875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3686 -4.4224 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.8913 -11.0171 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
8 9 2 0
8 10 1 0
7 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
10 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
6 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
18 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
30 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.54Molecular Weight (Monoisotopic): 521.1926AlogP: 5.37#Rotatable Bonds: 10Polar Surface Area: 99.60Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.58CX LogP: 4.88CX LogD: 1.17Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.11
References 1. (2018) Substituted n-([1,1''-biphenyl]-3-yl)-[1,1''-biphenyl]-3-carboxamide analogs as inhibitors for beta-catenin/b-cell lymphoma 9 interactions,