6-(2-aminoethoxy)-N-(6-(2-aminoethoxy)-4'-fluorobiphenyl-3-yl)-3',4'-difluorobiphenyl-3-carboxamide dihydrochloride

ID: ALA4472448

PubChem CID: 155535457

Max Phase: Preclinical

Molecular Formula: C29H28Cl2F3N3O3

Molecular Weight: 521.54

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.Cl.NCCOc1ccc(NC(=O)c2ccc(OCCN)c(-c3ccc(F)c(F)c3)c2)cc1-c1ccc(F)cc1

Standard InChI:  InChI=1S/C29H26F3N3O3.2ClH/c30-21-5-1-18(2-6-21)24-17-22(7-10-28(24)38-14-12-34)35-29(36)20-4-9-27(37-13-11-33)23(15-20)19-3-8-25(31)26(32)16-19;;/h1-10,15-17H,11-14,33-34H2,(H,35,36);2*1H

Standard InChI Key:  LNUFJJAUSXORAT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 41  0  0  0  0  0  0  0  0999 V2000
   11.6113   -2.1943    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.1275   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1264   -5.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8344   -5.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5441   -5.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5412   -4.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8326   -4.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8342   -6.4783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1264   -6.8867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5418   -6.8871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8302   -3.2066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5367   -2.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5342   -1.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2407   -1.5680    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5416   -7.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8334   -8.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8328   -8.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5410   -9.3344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2511   -8.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2482   -8.1065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9602   -9.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9601  -10.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6684  -10.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3757  -10.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3704   -9.3196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6616   -8.9171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0853  -10.5463    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.2474   -4.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9539   -4.4267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6596   -4.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6570   -3.1980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9427   -2.7923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2400   -3.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3626   -2.7858    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.5419  -10.1516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8346  -10.5610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8355  -11.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1282  -11.7875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.3686   -4.4224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8913  -11.0171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  4  8  1  0
  8  9  2  0
  8 10  1  0
  7 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 10 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
  6 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 18 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 30 39  1  0
M  END

Associated Targets(Human)

MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CTNNB1 Tchem beta-catenin-B-cell lymphoma 9 protein complex (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TCF7L2 Tbio Cadherin-1/Transcription factor 7-like 2 (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.54Molecular Weight (Monoisotopic): 521.1926AlogP: 5.37#Rotatable Bonds: 10
Polar Surface Area: 99.60Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 9.58CX LogP: 4.88CX LogD: 1.17
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.11

References

1.  (2018)  Substituted n-([1,1''-biphenyl]-3-yl)-[1,1''-biphenyl]-3-carboxamide analogs as inhibitors for beta-catenin/b-cell lymphoma 9 interactions, 

Source