(2R,3S,6R,7R)-15-(4-hydroxy-5,6-dimethoxy-3-methyl-2-pyridyl)-3,5,7,9,11,13-hexamethyl-pentadeca-4,8,10,13-tetraene-2,3,6-triol

ID: ALA4472557

PubChem CID: 155535981

Max Phase: Preclinical

Molecular Formula: C29H45NO6

Molecular Weight: 503.68

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1nc(C/C=C(\C)C/C(C)=C/C(C)=C/[C@@H](C)[C@@H](O)/C(C)=C/[C@](C)(O)[C@@H](C)O)c(C)c(O)c1OC

Standard InChI:  InChI=1S/C29H45NO6/c1-17(11-12-24-22(6)26(33)27(35-9)28(30-24)36-10)13-18(2)14-19(3)15-20(4)25(32)21(5)16-29(8,34)23(7)31/h11,14-16,20,23,25,31-32,34H,12-13H2,1-10H3,(H,30,33)/b17-11+,18-14+,19-15+,21-16+/t20-,23-,25-,29+/m1/s1

Standard InChI Key:  WLTRGKYFEWQYDP-ZNBNPLEZSA-N

Molfile:  

 
     RDKit          2D

 36 36  0  0  0  0  0  0  0  0999 V2000
    4.2946  -11.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2935  -11.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0015  -12.2924    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7112  -11.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7084  -11.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9997  -10.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9973   -9.8378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4145  -10.6490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4195  -12.2904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1266  -11.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8349  -12.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5420  -11.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2504  -12.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9574  -11.8763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6658  -12.2837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6671  -13.1009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3728  -11.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0812  -12.2815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7883  -11.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4966  -12.2793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2037  -11.8696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9120  -12.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4979  -13.0965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7870  -11.0546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0825  -13.0987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8362  -13.1054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5854  -12.2914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5848  -13.1086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5868  -10.6554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5866   -9.8382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2516  -13.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9133  -13.0943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6191  -11.8674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3274  -12.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6178  -11.0502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9075  -11.4572    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  5  8  1  0
  4  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 20 23  1  0
 19 24  1  1
 18 25  1  6
 11 26  1  0
  2 27  1  0
 27 28  1  0
  1 29  1  0
 29 30  1  0
 13 31  1  0
 22 32  1  0
 22 33  1  0
 33 34  1  0
 33 35  1  6
 22 36  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4472557

    ---

Associated Targets(Human)

OS-RC-2 (487 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ACHN (49357 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
786-0 (47912 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HK-2 (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.68Molecular Weight (Monoisotopic): 503.3247AlogP: 4.96#Rotatable Bonds: 12
Polar Surface Area: 112.27Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.90CX Basic pKa: 1.94CX LogP: 4.41CX LogD: 4.41
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.24Np Likeness Score: 1.47

References

1. Zhou X, Liang Z, Li K, Fang W, Tian Y, Luo X, Chen Y, Zhan Z, Zhang T, Liao S, Liu S, Liu Y, Fenical W, Tang L..  (2019)  Exploring the Natural Piericidins as Anti-Renal Cell Carcinoma Agents Targeting Peroxiredoxin 1.,  62  (15): [PMID:31298537] [10.1021/acs.jmedchem.9b00598]

Source