The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Nocarterphenyl B; 7-hydroxy-6-methoxy-5,8-bis(4-methoxyphenyl)-2H-benzo[b][1,4]thiazin-3(4H)-one ID: ALA4472763
PubChem CID: 155535814
Max Phase: Preclinical
Molecular Formula: C23H21NO5S
Molecular Weight: 423.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2c3c(c(-c4ccc(OC)cc4)c(O)c2OC)SCC(=O)N3)cc1
Standard InChI: InChI=1S/C23H21NO5S/c1-27-15-8-4-13(5-9-15)18-20-23(30-12-17(25)24-20)19(21(26)22(18)29-3)14-6-10-16(28-2)11-7-14/h4-11,26H,12H2,1-3H3,(H,24,25)
Standard InChI Key: VYRLOMIVJRYCPG-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
30.2099 -6.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0383 -6.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4475 -5.6988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8007 -5.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2697 -5.6965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6840 -6.4141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5092 -6.4147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9212 -5.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9795 -5.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5629 -4.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7376 -4.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3280 -5.7084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7495 -6.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5734 -6.4198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7991 -7.1264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.4486 -7.1278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5019 -5.7119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0838 -4.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7472 -5.6974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1630 -6.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2120 -7.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6821 -4.9830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5071 -4.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2084 -4.9879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0315 -4.9853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4386 -4.2750 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.0270 -3.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2038 -3.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7923 -4.2803 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7914 -2.8545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 25 2 0
24 4 2 0
4 1 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 23 1 0
22 5 1 0
3 5 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
4 9 1 0
1 15 1 0
2 16 1 0
12 17 1 0
17 18 1 0
8 19 1 0
19 20 1 0
15 21 1 0
22 23 2 0
24 25 1 0
24 29 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 423.49Molecular Weight (Monoisotopic): 423.1140AlogP: 4.80#Rotatable Bonds: 5Polar Surface Area: 77.02Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.83CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.57Np Likeness Score: 0.31