The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,3-O,O-dibenzyl-6-[4-(3-chloropropyl)-1,2,3-triazol-1-yl]-6-deoxy-L-ascorbic acid ID: ALA4473024
PubChem CID: 155536084
Max Phase: Preclinical
Molecular Formula: C25H26ClN3O5
Molecular Weight: 483.95
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O[C@H]([C@@H](O)Cn2cc(CCCCl)nn2)C(OCc2ccccc2)=C1OCc1ccccc1
Standard InChI: InChI=1S/C25H26ClN3O5/c26-13-7-12-20-14-29(28-27-20)15-21(30)22-23(32-16-18-8-3-1-4-9-18)24(25(31)34-22)33-17-19-10-5-2-6-11-19/h1-6,8-11,14,21-22,30H,7,12-13,15-17H2/t21-,22+/m0/s1
Standard InChI Key: NSTAPLWGXMEGGL-FCHUYYIVSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
28.5675 -30.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7421 -30.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8069 -30.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4821 -30.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1383 -29.5229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7887 -29.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5870 -29.7334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.0546 -31.4380 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2716 -31.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0788 -29.9646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.1325 -28.3343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8259 -28.7677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5192 -29.2010 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
25.3463 -28.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1652 -27.5177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3958 -27.2348 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8937 -27.8784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0741 -27.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4514 -31.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0385 -32.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8688 -31.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2781 -32.1444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8675 -32.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2761 -33.5572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0942 -33.5567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5019 -32.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0908 -32.1397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2238 -32.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8110 -32.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2153 -33.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0367 -33.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4459 -32.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6718 -27.1599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8547 -27.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4523 -26.4413 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 2 1 0
5 3 1 0
6 4 1 0
7 3 2 0
8 1 1 0
9 2 1 0
6 10 1 1
11 12 1 0
12 6 1 0
4 13 1 6
4 5 1 0
14 11 1 0
11 15 1 0
15 16 2 0
16 17 1 0
17 14 2 0
17 18 1 0
9 19 1 0
19 20 1 0
8 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 20 1 0
18 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 483.95Molecular Weight (Monoisotopic): 483.1561AlogP: 3.38#Rotatable Bonds: 12Polar Surface Area: 95.70Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.57CX Basic pKa: 0.56CX LogP: 3.49CX LogD: 3.49Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: -0.14
References 1. Macan AM, Harej A, Cazin I, Klobučar M, Stepanić V, Pavelić K, Pavelić SK, Schols D, Snoeck R, Andrei G, Raić-Malić S.. (2019) Antitumor and antiviral activities of 4-substituted 1,2,3-triazolyl-2,3-dibenzyl-L-ascorbic acid derivatives., 184 [PMID:31586832 ] [10.1016/j.ejmech.2019.111739 ]