(R)-2-Phenyl-N-(5-(3-(((5-(2-phenylacetamido)-1,3,4-thiadiazol-2-yl)amino)methyl)pyrrolidin-1-yl)-1,3,4-thiadiazol-2-yl)acetamide

ID: ALA4473143

PubChem CID: 155536209

Max Phase: Preclinical

Molecular Formula: C25H26N8O2S2

Molecular Weight: 534.67

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccccc1)Nc1nnc(NC[C@H]2CCN(c3nnc(NC(=O)Cc4ccccc4)s3)C2)s1

Standard InChI:  InChI=1S/C25H26N8O2S2/c34-20(13-17-7-3-1-4-8-17)27-23-30-29-22(36-23)26-15-19-11-12-33(16-19)25-32-31-24(37-25)28-21(35)14-18-9-5-2-6-10-18/h1-10,19H,11-16H2,(H,26,29)(H,27,30,34)(H,28,31,35)/t19-/m1/s1

Standard InChI Key:  LQZZAPPZBNMHEU-LJQANCHMSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   17.4151  -14.8121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8461  -15.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0047  -15.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9181  -14.8785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5600  -16.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3442  -16.1385    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.5381  -14.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6720  -15.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2666  -15.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1390  -16.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8344  -14.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2587  -14.7879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7164  -16.0514    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.4234  -15.6335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7395  -14.8685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9660  -16.0836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0819  -15.8020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2196  -15.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6758  -14.1505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9568  -15.3816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5524  -15.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8859  -15.8873    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.5046  -15.8127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2592  -15.8169    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8025  -14.5753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3736  -15.3860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2967  -14.6222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1439  -16.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6649  -15.7938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3831  -14.5665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0082  -15.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7964  -15.3966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5532  -16.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3451  -16.6256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9604  -14.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4753  -14.6222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2567  -15.6793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15  4  1  0
  5  9  1  0
  7 11  2  0
 11  2  1  0
  8  6  1  0
 12  7  1  0
  4  8  2  0
  9 12  2  0
 14 10  1  0
  3 13  1  0
  6  3  1  0
 10  2  1  0
 14  1  2  0
 13 14  1  0
  3 15  2  0
  2  5  2  0
  8 16  1  0
 20 29  2  0
 21 27  2  0
 31 24  1  0
 24 34  1  0
 18 22  1  0
 23 32  1  0
 19 35  2  0
 33 31  1  0
 32 17  1  0
 36 18  2  0
 29 26  1  0
 26 30  2  0
 18 23  1  0
 28 33  1  0
 22 21  1  0
 30 19  1  0
 32 25  2  0
 27 36  1  0
 34 28  1  0
 17 26  1  0
 35 20  1  0
 21 24  1  0
 33 37  1  1
 37 16  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4473143

    ---

Associated Targets(Human)

GLS Tchem Glutaminase kidney isoform, mitochondrial (16997 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
GLS2 Tchem Glutaminase liver isoform, mitochondrial (47 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.67Molecular Weight (Monoisotopic): 534.1620AlogP: 3.69#Rotatable Bonds: 10
Polar Surface Area: 125.03Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.78CX Basic pKa: 0.04CX LogP: 3.85CX LogD: 2.96
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.28Np Likeness Score: -1.46

References

1. Finlay MRV, Anderton M, Bailey A, Boyd S, Brookfield J, Cairnduff C, Charles M, Cheasty A, Critchlow SE, Culshaw J, Ekwuru T, Hollingsworth I, Jones N, Leroux F, Littleson M, McCarron H, McKelvie J, Mooney L, Nissink JWM, Perkins D, Powell S, Quesada MJ, Raubo P, Sabin V, Smith J, Smith PD, Stark A, Ting A, Wang P, Wilson Z, Winter-Holt JJ, Wood JM, Wrigley GL, Yu G, Zhang P..  (2019)  Discovery of a Thiadiazole-Pyridazine-Based Allosteric Glutaminase 1 Inhibitor Series That Demonstrates Oral Bioavailability and Activity in Tumor Xenograft Models.,  62  (14): [PMID:31199640] [10.1021/acs.jmedchem.9b00260]

Source