1-(4-((3-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)isoxazol-5-yl)methoxy)phenyl)-3-phenylprop-2-en-1-one

ID: ALA4473153

PubChem CID: 132578488

Max Phase: Preclinical

Molecular Formula: C27H21NO5

Molecular Weight: 439.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1ccccc1)c1ccc(OCc2cc(-c3ccc4c(c3)OCCO4)no2)cc1

Standard InChI:  InChI=1S/C27H21NO5/c29-25(12-6-19-4-2-1-3-5-19)20-7-10-22(11-8-20)32-18-23-17-24(28-33-23)21-9-13-26-27(16-21)31-15-14-30-26/h1-13,16-17H,14-15,18H2/b12-6+

Standard InChI Key:  FSZNGACEZPGHHC-WUXMJOGZSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   10.0550  -12.6994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7679  -12.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4689  -12.7189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0431  -13.5165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1817  -12.3159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1936  -11.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9065  -11.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6075  -11.5183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5997  -12.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8869  -12.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3540  -12.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6411  -12.6799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9360  -12.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9479  -11.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6608  -11.0457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3618  -11.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2469  -11.0304    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2547  -10.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8041  -10.1147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2641   -9.5017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6824   -8.8007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4773   -8.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5537   -9.7950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1400   -5.9190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5265   -6.6382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3404   -6.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7718   -5.9717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3890   -5.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5710   -5.2218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7270   -7.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2959   -8.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4776   -8.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0951   -7.3313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  1  4  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  3  5  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 17 18  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 19 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 24 29  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 25 33  2  0
 26 30  2  0
 21 31  1  0
 18 23  1  0
 14 17  1  0
  1 11  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4473153

    ---

Associated Targets(non-human)

Tyr Tyrosinase (438 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
B16-F10 (4610 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPO2 Tyrosinase (3884 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.47Molecular Weight (Monoisotopic): 439.1420AlogP: 5.59#Rotatable Bonds: 7
Polar Surface Area: 70.79Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.29CX LogD: 5.29
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -0.87

References

1. Niu C, Yin L, Nie LF, Dou J, Zhao JY, Li G, Aisa HA..  (2016)  Synthesis and bioactivity of novel isoxazole chalcone derivatives on tyrosinase and melanin synthesis in murine B16 cells for the treatment of vitiligo.,  24  (21): [PMID:27622747] [10.1016/j.bmc.2016.08.066]

Source