1-O-p-Nitrobenzoyllycorine

ID: ALA4473154

PubChem CID: 155536248

Max Phase: Preclinical

Molecular Formula: C23H20N2O7

Molecular Weight: 436.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O[C@H]1[C@H]2c3cc4c(cc3CN3CCC(=C[C@@H]1O)[C@H]23)OCO4)c1ccc([N+](=O)[O-])cc1

Standard InChI:  InChI=1S/C23H20N2O7/c26-17-7-13-5-6-24-10-14-8-18-19(31-11-30-18)9-16(14)20(21(13)24)22(17)32-23(27)12-1-3-15(4-2-12)25(28)29/h1-4,7-9,17,20-22,26H,5-6,10-11H2/t17-,20-,21+,22+/m0/s1

Standard InChI Key:  MALJMCIIEURZLS-GUGJDKNPSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   16.6451  -13.9831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9435  -14.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3509  -15.2088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3509  -14.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0525  -13.9954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9476  -15.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0608  -13.1782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6369  -13.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2419  -14.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6492  -15.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3509  -12.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2460  -15.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1268  -15.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6055  -14.7961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9435  -12.7696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6369  -14.7920    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   17.3509  -13.5827    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.5353  -15.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5444  -14.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7699  -14.1387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2822  -14.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7553  -15.4610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3554  -11.9442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9435  -11.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2358  -11.5438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6512  -11.5439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2408  -10.7256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5339  -10.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8252  -10.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8278  -11.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5353  -11.9519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1141  -10.3145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4069  -10.7240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1130   -9.4973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  1  0
  5  4  1  0
  6  2  1  0
  7 11  1  0
  8  1  1  0
  9  2  2  0
 10  3  1  0
 11  8  1  0
 19  9  1  0
 12  6  2  0
 13  3  1  0
 14  5  1  0
  8 15  1  6
  1 16  1  1
  4 17  1  6
  5  7  2  0
 13 14  1  0
  6 10  1  0
 12 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 18  1  0
 11 23  1  1
 15 24  1  0
 24 25  1  0
 24 26  2  0
 25 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 25  1  0
 32 33  2  0
 32 34  1  0
 29 32  1  0
M  CHG  2  32   1  34  -1
M  END

Alternative Forms

  1. Parent:

    ALA4473154

    ---

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.42Molecular Weight (Monoisotopic): 436.1271AlogP: 2.52#Rotatable Bonds: 3
Polar Surface Area: 111.37Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.76CX Basic pKa: 7.91CX LogP: 2.60CX LogD: 1.97
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.34Np Likeness Score: 1.24

References

1. Nair JJ, van Staden J..  (2019)  Antiprotozoal alkaloid principles of the plant family Amaryllidaceae.,  29  (20): [PMID:31515186] [10.1016/j.bmcl.2019.126642]

Source