N-(3-(1H-indazol-6-yl)-4-methoxyphenyl)-3-(trifluoromethyl)benzamide

ID: ALA4473495

PubChem CID: 155536159

Max Phase: Preclinical

Molecular Formula: C22H16F3N3O2

Molecular Weight: 411.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1-c1ccc2cn[nH]c2c1

Standard InChI:  InChI=1S/C22H16F3N3O2/c1-30-20-8-7-17(11-18(20)13-5-6-15-12-26-28-19(15)10-13)27-21(29)14-3-2-4-16(9-14)22(23,24)25/h2-12H,1H3,(H,26,28)(H,27,29)

Standard InChI Key:  JQYWBNMMSSKERC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    3.9412  -16.7510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6509  -16.3415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6481  -15.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9394  -15.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3512  -15.1089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0607  -15.5165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7664  -15.1060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7638  -14.2879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0496  -13.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3468  -14.2951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2332  -16.3420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2299  -15.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4523  -15.2763    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9750  -15.9388    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4577  -16.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4755  -15.5122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1818  -15.1013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8909  -15.5076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1791  -14.2841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8900  -16.3243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5982  -16.7305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3055  -16.3195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3002  -15.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5914  -15.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0076  -15.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6490  -14.7046    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.8079  -15.3788    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.0267  -14.2203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6364  -13.8911    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6311  -13.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 11  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 12  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 11  1  0
  7 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 18  1  0
 25 26  1  0
 25 27  1  0
 25 28  1  0
 23 25  1  0
 10 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4473495

    ---

Associated Targets(Human)

DDR2 Tchem Discoidin domain-containing receptor 2 (2199 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 411.38Molecular Weight (Monoisotopic): 411.1195AlogP: 5.51#Rotatable Bonds: 4
Polar Surface Area: 67.01Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.88CX Basic pKa: 1.65CX LogP: 4.76CX LogD: 4.76
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.66

References

1. Wang Q, Dai Y, Ji Y, Shi H, Guo Z, Chen D, Chen Y, Peng X, Gao Y, Wang X, Chen L, Jiang Y, Geng M, Shen J, Ai J, Xiong B..  (2019)  Discovery and optimization of a series of 3-substituted indazole derivatives as multi-target kinase inhibitors for the treatment of lung squamous cell carcinoma.,  163  [PMID:30572178] [10.1016/j.ejmech.2018.12.015]

Source