(R)-3',5-dihydroxy-4',5',7-trimethoxy-2'H-spiro[chroman-3,1'-cyclobutabenzen]-4-one

ID: ALA4473554

PubChem CID: 73212710

Max Phase: Preclinical

Molecular Formula: C19H18O7

Molecular Weight: 358.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)OC[C@]1(Cc3c1cc(OC)c(OC)c3O)C2=O

Standard InChI:  InChI=1S/C19H18O7/c1-23-9-4-12(20)15-13(5-9)26-8-19(18(15)22)7-10-11(19)6-14(24-2)17(25-3)16(10)21/h4-6,20-21H,7-8H2,1-3H3/t19-/m0/s1

Standard InChI Key:  JWPTZLDMDIRBAI-IBGZPJMESA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   15.0125   -4.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0083   -5.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8333   -5.1878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8374   -4.3628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1524   -3.5290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1513   -4.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8661   -4.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8643   -3.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5796   -3.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5785   -4.3539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2914   -4.7668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0112   -3.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2938   -3.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2891   -5.5918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5452   -5.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2616   -5.1892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2588   -4.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5434   -3.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9716   -3.9435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9767   -5.6006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5434   -6.4276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9779   -6.4256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6877   -4.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4379   -3.1167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4377   -2.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8678   -5.5942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  6
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7 10  2  0
  9  8  2  0
  8  5  1  0
  9 10  1  0
  9 13  1  0
 10 11  1  0
 11  1  1  0
  1 12  1  0
 12 13  1  0
 11 14  2  0
  3 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18  4  1  0
 17 19  1  0
 16 20  1  0
 15 21  1  0
 20 22  1  0
 19 23  1  0
  5 24  1  0
 24 25  1  0
  7 26  1  0
M  END

Associated Targets(Human)

Y79 (258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HUVEC (11049 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.35Molecular Weight (Monoisotopic): 358.1053AlogP: 2.19#Rotatable Bonds: 3
Polar Surface Area: 94.45Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.62CX Basic pKa: CX LogP: 2.72CX LogD: 2.69
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.87Np Likeness Score: 1.61

References

1. Schwikkard S, Whitmore H, Sishtla K, Sulaiman RS, Shetty T, Basavarajappa HD, Waller C, Alqahtani A, Frankemoelle L, Chapman A, Crouch N, Wetschnig W, Knirsch W, Andriantiana J, Mas-Claret E, Langat MK, Mulholland D, Corson TW..  (2019)  The Antiangiogenic Activity of Naturally Occurring and Synthetic Homoisoflavonoids from the Hyacinthaceae ( sensu APGII).,  82  (5): [PMID:30951308] [10.1021/acs.jnatprod.8b00989]

Source