The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((1-(2-(2-(2-(2-aminoethylamino)ethylamino)ethylamino)-2-oxoethyl)quinolin-4(1H)-ylidene)methyl)-3-methylbenzo[d]thiazol-3-ium chloride ID: ALA4474033
PubChem CID: 155536754
Max Phase: Preclinical
Molecular Formula: C26H33ClN6OS
Molecular Weight: 477.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[n+]1c(/C=C2\C=CN(CC(=O)NCCNCCNCCN)c3ccccc32)sc2ccccc21.[Cl-]
Standard InChI: InChI=1S/C26H32N6OS.ClH/c1-31-23-8-4-5-9-24(23)34-26(31)18-20-10-17-32(22-7-3-2-6-21(20)22)19-25(33)30-16-15-29-14-13-28-12-11-27;/h2-10,17-18,28-29H,11-16,19,27H2,1H3;1H
Standard InChI Key: FRWWTEQBCPYSKQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
6.7274 -13.0668 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.2892 -13.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2880 -14.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9961 -15.2198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9943 -13.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7029 -13.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7032 -14.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4862 -15.0650 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.9699 -14.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4857 -13.7331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7871 -14.3986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1959 -15.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7825 -15.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1879 -16.5222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0054 -16.5262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0089 -15.1068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4140 -15.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2313 -15.8230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6445 -15.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2344 -14.4032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4184 -14.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4122 -17.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7380 -12.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2294 -17.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6362 -17.9457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6398 -16.5303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4570 -16.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8673 -15.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6845 -15.8278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0949 -15.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9121 -15.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3225 -14.4165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1397 -14.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5501 -13.7119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3673 -13.7140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 6 1 0
9 11 1 0
11 12 2 0
12 13 1 0
12 16 1 0
13 14 2 0
14 15 1 0
15 17 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
15 22 1 0
10 23 1 0
22 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M CHG 2 1 -1 10 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.66Molecular Weight (Monoisotopic): 477.2431AlogP: 1.85#Rotatable Bonds: 11Polar Surface Area: 86.30Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.56CX LogP: -2.40CX LogD: -5.75Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.25Np Likeness Score: -0.61
References 1. Wang S, Yang D, Singh M, Joo H, Rangel VM, Tran A, Phan E, Xue L.. (2019) Thiazole orange - Spermine conjugate: A potent human telomerase inhibitor comparable to BRACO-19., 175 [PMID:31071547 ] [10.1016/j.ejmech.2019.04.041 ]