Methyl-(S)-3-(4-(benzyloxy)phenyl)-2-(2-(1-(3-(4-ethoxyphenyl)propanoyl)piperidin-4-yl)acetamido)propanoate

ID: ALA4474075

PubChem CID: 134355766

Max Phase: Preclinical

Molecular Formula: C35H42N2O6

Molecular Weight: 586.73

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1ccc(CCC(=O)N2CCC(CC(=O)N[C@@H](Cc3ccc(OCc4ccccc4)cc3)C(=O)OC)CC2)cc1

Standard InChI:  InChI=1S/C35H42N2O6/c1-3-42-30-14-9-26(10-15-30)13-18-34(39)37-21-19-28(20-22-37)24-33(38)36-32(35(40)41-2)23-27-11-16-31(17-12-27)43-25-29-7-5-4-6-8-29/h4-12,14-17,28,32H,3,13,18-25H2,1-2H3,(H,36,38)/t32-/m0/s1

Standard InChI Key:  QKPHMHGXXVLNMK-YTTGMZPUSA-N

Molfile:  

 
     RDKit          2D

 43 46  0  0  0  0  0  0  0  0999 V2000
   33.1329  -22.3859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.8463  -21.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5640  -22.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5640  -23.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8463  -23.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1329  -23.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2772  -23.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9905  -23.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9905  -22.3862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.7036  -23.6264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4210  -23.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1342  -23.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8474  -23.2117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5648  -23.6264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1342  -24.4518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.4210  -22.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1342  -21.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8479  -22.3865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5599  -21.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5631  -21.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8453  -20.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1286  -21.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2764  -20.7392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.9896  -21.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7027  -20.7392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4205  -21.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1285  -20.7425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1317  -19.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4181  -19.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.7013  -19.9166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4196  -21.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4196  -21.1498    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.7023  -22.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9890  -21.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2759  -22.3859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5622  -21.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8501  -22.3825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8469  -23.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5605  -23.6225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2773  -23.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1319  -23.6169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4200  -23.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7050  -23.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  2  0
 11 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 17 22  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 25 30  1  0
  1 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 35 40  1  0
 38 41  1  0
 41 42  1  0
 42 43  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474075

    ---

Associated Targets(Human)

NCI-H1650 (1118 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
YAP1 Tchem Transcriptional coactivator YAP1 (194 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 586.73Molecular Weight (Monoisotopic): 586.3043AlogP: 5.13#Rotatable Bonds: 14
Polar Surface Area: 94.17Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.25CX Basic pKa: CX LogP: 4.99CX LogD: 4.99
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.26Np Likeness Score: -0.68

References

1.  (2018)  Yap1 inhibitors that target the interaction of yap1 with oct4, 

Source