The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl-(S)-3-(4-(benzyloxy)phenyl)-2-(2-(1-(3-(4-ethoxyphenyl)propanoyl)piperidin-4-yl)acetamido)propanoate ID: ALA4474075
PubChem CID: 134355766
Max Phase: Preclinical
Molecular Formula: C35H42N2O6
Molecular Weight: 586.73
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(CCC(=O)N2CCC(CC(=O)N[C@@H](Cc3ccc(OCc4ccccc4)cc3)C(=O)OC)CC2)cc1
Standard InChI: InChI=1S/C35H42N2O6/c1-3-42-30-14-9-26(10-15-30)13-18-34(39)37-21-19-28(20-22-37)24-33(38)36-32(35(40)41-2)23-27-11-16-31(17-12-27)43-25-29-7-5-4-6-8-29/h4-12,14-17,28,32H,3,13,18-25H2,1-2H3,(H,36,38)/t32-/m0/s1
Standard InChI Key: QKPHMHGXXVLNMK-YTTGMZPUSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
33.1329 -22.3859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.8463 -21.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5640 -22.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5640 -23.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8463 -23.6266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1329 -23.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2772 -23.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9905 -23.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9905 -22.3862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.7036 -23.6264 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.4210 -23.2117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1342 -23.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8474 -23.2117 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.5648 -23.6264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1342 -24.4518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4210 -22.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1342 -21.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8479 -22.3865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5599 -21.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5631 -21.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8453 -20.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1286 -21.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2764 -20.7392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.9896 -21.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7027 -20.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4205 -21.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1285 -20.7425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1317 -19.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4181 -19.5066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7013 -19.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4196 -21.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4196 -21.1498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7023 -22.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9890 -21.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2759 -22.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5622 -21.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8501 -22.3825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8469 -23.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5605 -23.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2773 -23.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1319 -23.6169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4200 -23.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7050 -23.6118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
4 7 1 0
7 8 1 0
8 9 2 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
12 15 2 0
11 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
17 22 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
25 30 1 0
1 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
35 40 1 0
38 41 1 0
41 42 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.73Molecular Weight (Monoisotopic): 586.3043AlogP: 5.13#Rotatable Bonds: 14Polar Surface Area: 94.17Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.25CX Basic pKa: ┄CX LogP: 4.99CX LogD: 4.99Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.26Np Likeness Score: -0.68
References 1. (2018) Yap1 inhibitors that target the interaction of yap1 with oct4,