The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,7S,8S)-3,8-Dibenzyl-7-hydroxy-1,4,9-triazacyclohenicosane-2,5,10-trione ID: ALA4474088
PubChem CID: 155536787
Max Phase: Preclinical
Molecular Formula: C32H45N3O4
Molecular Weight: 535.73
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C[C@H](O)[C@H](Cc2ccccc2)NC(=O)CCCCCCCCCCCNC(=O)[C@H](Cc2ccccc2)N1
Standard InChI: InChI=1S/C32H45N3O4/c36-29-24-31(38)35-28(23-26-18-12-9-13-19-26)32(39)33-21-15-7-5-3-1-2-4-6-14-20-30(37)34-27(29)22-25-16-10-8-11-17-25/h8-13,16-19,27-29,36H,1-7,14-15,20-24H2,(H,33,39)(H,34,37)(H,35,38)/t27-,28-,29-/m0/s1
Standard InChI Key: JYKLPRVNXSFXRG-AWCRTANDSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
31.6847 -23.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3718 -23.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0630 -23.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7501 -23.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4372 -23.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1201 -23.1372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8072 -23.5335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8072 -24.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6847 -24.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4901 -24.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4901 -25.6301 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.9977 -24.7221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9977 -25.5145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3106 -25.9149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6847 -25.9149 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.6847 -26.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3718 -27.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0630 -26.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7501 -27.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4372 -26.7073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7501 -27.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.3718 -27.8959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1201 -27.1035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0011 -26.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1201 -27.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9809 -27.1113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5696 -27.3110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.9788 -27.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2710 -28.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2685 -29.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9757 -29.5594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6868 -29.1482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6858 -28.3332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8278 -28.3045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8257 -29.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5326 -29.5313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2413 -29.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2386 -28.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5312 -27.8964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
1 9 1 0
8 10 1 0
10 11 1 0
9 12 1 0
12 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
17 22 1 6
20 23 1 0
23 24 1 0
23 25 1 6
24 11 1 0
16 26 1 6
24 27 2 0
26 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
25 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.73Molecular Weight (Monoisotopic): 535.3410AlogP: 4.22#Rotatable Bonds: 4Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.80CX Basic pKa: ┄CX LogP: 4.67CX LogD: 4.67Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.47Np Likeness Score: 0.62
References 1. Houštecká R, Hadzima M, Fanfrlík J, Brynda J, Pallová L, Hánová I, Mertlíková-Kaiserová H, Lepšík M, Horn M, Smrčina M, Majer P, Mareš M.. (2020) Biomimetic Macrocyclic Inhibitors of Human Cathepsin D: Structure-Activity Relationship and Binding Mode Analysis., 63 (4): [PMID:32003991 ] [10.1021/acs.jmedchem.9b01351 ]