The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-bromo-7-(5-(6,7-dimethoxy-3,4-dihydroisoquinolin-2(1H)-yl)pentyloxy)-4-methyl-2H-chromen-2-one ID: ALA4474108
PubChem CID: 155536529
Max Phase: Preclinical
Molecular Formula: C26H30BrNO5
Molecular Weight: 516.43
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)CN(CCCCCOc1ccc3c(C)c(Br)c(=O)oc3c1)CC2
Standard InChI: InChI=1S/C26H30BrNO5/c1-17-21-8-7-20(15-22(21)33-26(29)25(17)27)32-12-6-4-5-10-28-11-9-18-13-23(30-2)24(31-3)14-19(18)16-28/h7-8,13-15H,4-6,9-12,16H2,1-3H3
Standard InChI Key: SVZFJRJPPXMZOB-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.0237 -12.7492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0226 -13.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7306 -13.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7289 -12.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4375 -12.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4363 -13.5663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1425 -13.9753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8544 -13.5683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8555 -12.7476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1448 -12.3340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5642 -12.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2710 -12.7511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9797 -12.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3159 -12.3408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6083 -12.7496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3146 -13.9768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6072 -13.5676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6864 -12.7545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3951 -12.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1018 -12.7579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8115 -12.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5165 -12.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5194 -11.1316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8131 -11.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2301 -11.5435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2217 -12.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9195 -12.7711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6302 -12.3731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6386 -11.5581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9363 -11.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3331 -12.7900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3509 -11.1575 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
12.9436 -10.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
11 12 1 0
12 13 1 0
1 14 1 0
14 15 1 0
2 16 1 0
16 17 1 0
13 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 26 1 0
25 23 1 0
23 24 2 0
24 21 1 0
25 26 2 0
25 30 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
28 31 2 0
29 32 1 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.43Molecular Weight (Monoisotopic): 515.1307AlogP: 5.49#Rotatable Bonds: 9Polar Surface Area: 61.14Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.19CX LogP: 5.24CX LogD: 4.39Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -0.36
References 1. Rullo M, Niso M, Pisani L, Carrieri A, Colabufo NA, Cellamare S, Altomare CD.. (2019) 1,2,3,4-Tetrahydroisoquinoline/2H-chromen-2-one conjugates as nanomolar P-glycoprotein inhibitors: Molecular determinants for affinity and selectivity over multidrug resistance associated protein 1., 161 [PMID:30384046 ] [10.1016/j.ejmech.2018.10.043 ]