N-(1-(benzo[b]thiophen-2-yl)-2-(3,4-dichlorophenyl)-3-(4-(methylthio)phenyl)-3-oxopropyl)-4-methylbenzamide

ID: ALA4474146

PubChem CID: 155536791

Max Phase: Preclinical

Molecular Formula: C32H25Cl2NO2S2

Molecular Weight: 590.60

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CSc1ccc(C(=O)C(c2ccc(Cl)c(Cl)c2)C(NC(=O)c2ccc(C)cc2)c2cc3ccccc3s2)cc1

Standard InChI:  InChI=1S/C32H25Cl2NO2S2/c1-19-7-9-21(10-8-19)32(37)35-30(28-18-22-5-3-4-6-27(22)39-28)29(23-13-16-25(33)26(34)17-23)31(36)20-11-14-24(38-2)15-12-20/h3-18,29-30H,1-2H3,(H,35,37)

Standard InChI Key:  JRZXCUULQDVSHE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    2.1759  -14.2209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1747  -15.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8904  -15.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6076  -15.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6048  -14.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8885  -13.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3194  -15.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3207  -16.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0340  -15.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7500  -15.4553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0328  -14.2206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7476  -13.8103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7466  -12.9857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0301  -12.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3131  -12.9915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3176  -13.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6102  -16.6987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4605  -13.8064    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.8861  -12.9806    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.0278  -11.7501    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.7418  -11.3334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8567  -16.3645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5228  -17.5223    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7199  -17.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3060  -16.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4853  -16.9833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0774  -17.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4921  -18.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3116  -18.4052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0366  -16.6964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0379  -17.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3233  -17.9335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7508  -17.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7508  -18.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4658  -19.1685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1815  -18.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1776  -17.9231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4619  -17.5174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8979  -19.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 17  1  0
  1 18  1  0
  6 19  1  0
 14 20  1  0
 20 21  1  0
 17 22  2  0
 22 25  1  0
 24 23  1  0
 23 17  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  8 30  1  0
 30 31  1  0
 31 32  2  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
 31 33  1  0
 36 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474146

    ---

Associated Targets(non-human)

Vero (26788 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Leishmania donovani (89745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 590.60Molecular Weight (Monoisotopic): 589.0704AlogP: 9.38#Rotatable Bonds: 8
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.32CX Basic pKa: CX LogP: 9.34CX LogD: 9.34
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.14Np Likeness Score: -1.06

References

1. Chandrakar P, Gunaganti N, Parmar N, Kumar A, Singh SK, Rashid M, Wahajuddin M, Mitra K, Narender T, Kar S..  (2019)  β-Amino acid derivatives as mitochondrial complex III inhibitors of L. donovani: A promising chemotype targeting visceral leishmaniasis.,  182  [PMID:31499363] [10.1016/j.ejmech.2019.111632]

Source