7'-(trifluoromethyl)-5H-spiro[benzo[h]tetrazolo[5,1-b]quinazoline-7,3'-indoline]-2',5,6(9H)-trione

ID: ALA4474159

PubChem CID: 155536997

Max Phase: Preclinical

Molecular Formula: C20H9F3N6O3

Molecular Weight: 438.33

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1C(=O)c2ccccc2C2=C1C1(C(=O)Nc3c(C(F)(F)F)cccc31)N1NN=NC1=N2

Standard InChI:  InChI=1S/C20H9F3N6O3/c21-20(22,23)11-7-3-6-10-14(11)24-17(32)19(10)12-13(25-18-26-27-28-29(18)19)8-4-1-2-5-9(8)15(30)16(12)31/h1-7H,(H,24,32)(H,25,26,28)

Standard InChI Key:  XIMCLPMSNGKUEF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   36.1006  -11.5709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.0823  -10.6891    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2712  -10.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5500  -10.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5489  -11.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2569  -11.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2551   -9.9216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9638  -10.3268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9626  -11.1520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3897  -10.3289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6750   -9.9130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3885  -11.1541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6694  -11.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6616  -12.3814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0903  -12.3967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.3720  -12.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5359  -13.6108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.3555  -13.7048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6980  -12.9544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4131  -11.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8079  -11.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9740  -12.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7447  -13.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3496  -12.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1804  -11.6845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6751   -9.0958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.3827   -9.5091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.7251  -10.1655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7865  -11.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3389  -10.6349    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   39.6304  -11.2632    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.7442  -10.2797    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1 21  1  0
 20  2  1  0
  2  3  1  0
  3  1  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 11  1  0
  9 13  1  0
 12 10  1  0
 10 11  1  0
 12 13  2  0
 12  1  1  0
 13 14  1  0
 14 16  2  0
 15  1  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 11 26  2  0
 10 27  2  0
  3 28  2  0
 29 30  1  0
 29 31  1  0
 29 32  1  0
 25 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474159

    ---

Associated Targets(Human)

L02 (4864 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
HepG2 (196354 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.33Molecular Weight (Monoisotopic): 438.0688AlogP: 2.59#Rotatable Bonds:
Polar Surface Area: 115.59Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.42CX Basic pKa: CX LogP: 2.79CX LogD: 2.79
Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.61Np Likeness Score: -0.36

References

1. da Silva Júnior EN, Jardim GAM, Jacob C, Dhawa U, Ackermann L, de Castro SL..  (2019)  Synthesis of quinones with highlighted biological applications: A critical update on the strategies towards bioactive compounds with emphasis on lapachones.,  179  [PMID:31306817] [10.1016/j.ejmech.2019.06.056]

Source