(1R,4r)-4-(4-((R)-1-(3-amino-5-(trifluoromethyl)phenyl)ethylamino)-2-methylquinazolin-6-yl)-N-(2-methoxyethyl)-N-methylcyclohexanecarboxamide

ID: ALA4474160

PubChem CID: 155536998

Max Phase: Preclinical

Molecular Formula: C29H36F3N5O2

Molecular Weight: 543.63

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COCCN(C)C(=O)[C@H]1CC[C@H](c2ccc3nc(C)nc(N[C@H](C)c4cc(N)cc(C(F)(F)F)c4)c3c2)CC1

Standard InChI:  InChI=1S/C29H36F3N5O2/c1-17(22-13-23(29(30,31)32)16-24(33)14-22)34-27-25-15-21(9-10-26(25)35-18(2)36-27)19-5-7-20(8-6-19)28(38)37(3)11-12-39-4/h9-10,13-17,19-20H,5-8,11-12,33H2,1-4H3,(H,34,35,36)/t17-,19-,20-/m1/s1

Standard InChI Key:  ILEAWXKITCTYRN-MISYRCLQSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    8.0358   -6.6546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4644   -9.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7138   -6.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0360   -5.8312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2920   -8.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7524   -4.5854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2902   -6.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8805   -9.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7552   -5.4144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7528   -7.8859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4171   -7.8797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0001   -7.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7149   -5.8333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9979   -7.8790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8365   -7.0647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1741   -9.5214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6065   -3.3557    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.5782   -7.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1276   -6.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8960   -4.5818    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.0344   -9.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4222   -7.0611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.7530   -7.0623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1708   -7.8810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7522   -9.5286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3225   -5.4149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6055   -4.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3236   -4.5890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8770   -8.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0349   -8.2972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8902   -3.7614    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.4594   -4.1743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0342   -4.1811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5849   -7.8771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3225   -7.0620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4648   -8.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3210   -9.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5458   -6.6589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2519   -7.0703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 22 19  1  0
 34 18  1  0
 24 36  2  0
  3 22  1  0
  3 13  2  0
  6 32  1  0
 23 10  1  0
 34  5  1  0
  4  1  1  0
  1 23  1  0
 36 10  1  0
 21 25  2  0
 21 37  1  0
 15 19  1  0
 14 12  1  0
  5 14  1  0
 27 20  1  0
 12  7  1  0
 22 11  1  0
  8 29  2  0
 28 26  2  0
  9  6  1  0
 12  3  1  1
 27 17  1  0
 33 28  1  0
 30 21  1  0
 26  4  1  0
 28 27  1  0
 36  2  1  0
  1 35  1  6
  6 33  2  0
 34 29  1  6
  7 18  1  0
 25  2  1  0
 27 31  1  0
 10 30  2  0
  4  9  2  0
 29 24  1  0
  2 16  2  0
 16  8  1  0
 15 38  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474160

    ---

Associated Targets(Human)

SOS1 Tchem Son of sevenless homolog 1 (1023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.63Molecular Weight (Monoisotopic): 543.2821AlogP: 6.09#Rotatable Bonds: 8
Polar Surface Area: 93.37Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.89CX LogP: 5.20CX LogD: 5.19
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.33Np Likeness Score: -1.37

References

1.  (2018)  Novel benzylamino substituted quinazolines and derivatives as sos1 inhibitors, 

Source