The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(5-bromo-2-methoxyphenyl)-1-phenyl-1H-pyrrol-3-yl)(3,4,5-trimethoxyphenyl)-methanone ID: ALA4474169
PubChem CID: 155537005
Max Phase: Preclinical
Molecular Formula: C27H24BrNO5
Molecular Weight: 522.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Br)cc1-c1cn(-c2ccccc2)cc1C(=O)c1cc(OC)c(OC)c(OC)c1
Standard InChI: InChI=1S/C27H24BrNO5/c1-31-23-11-10-18(28)14-20(23)21-15-29(19-8-6-5-7-9-19)16-22(21)26(30)17-12-24(32-2)27(34-4)25(13-17)33-3/h5-16H,1-4H3
Standard InChI Key: KHATWJKLRATHAP-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.2311 -27.8820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0465 -27.8832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4535 -27.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0461 -26.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2275 -26.4754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8243 -27.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0071 -27.1829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5964 -26.4764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6006 -27.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1921 -29.1506 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8550 -28.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7835 -27.8918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5291 -28.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3707 -27.1819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7821 -26.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3701 -25.7606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5480 -25.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1398 -26.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5542 -27.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1914 -29.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4820 -30.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4817 -31.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1899 -31.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9000 -31.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8968 -30.3723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4546 -28.5912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2706 -27.1789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4536 -25.7643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2707 -25.7630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0454 -29.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6791 -27.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1500 -27.8967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3328 -27.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7769 -25.0518 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 2 0
7 9 1 0
12 13 2 0
11 9 2 0
10 11 1 0
9 12 1 0
13 10 1 0
12 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
10 20 1 0
2 26 1 0
3 27 1 0
4 28 1 0
28 29 1 0
26 30 1 0
27 31 1 0
19 32 1 0
32 33 1 0
16 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 522.40Molecular Weight (Monoisotopic): 521.0838AlogP: 6.17#Rotatable Bonds: 8Polar Surface Area: 58.92Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.18CX LogD: 6.18Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.38
References 1. Puxeddu M, Shen H, Bai R, Coluccia A, Nalli M, Mazzoccoli C, Da Pozzo E, Cavallini C, Martini C, Orlando V, Biagioni S, Mazzoni C, Coluccia AML, Hamel E, Liu T, Silvestri R, La Regina G.. (2020) Structure-activity relationship studies and in vitro and in vivo anticancer activity of novel 3-aroyl-1,4-diarylpyrroles against solid tumors and hematological malignancies., 185 [PMID:31727471 ] [10.1016/j.ejmech.2019.111828 ]