The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((1-Amino-2-methyl-1-oxopropan-2-yl)carbamoyl)benzyl)-1-(o-tolyl)-1H-pyrazole-4-carboxamide ID: ALA4474175
PubChem CID: 155536847
Max Phase: Preclinical
Molecular Formula: C23H25N5O3
Molecular Weight: 419.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1-n1cc(C(=O)NCc2ccc(C(=O)NC(C)(C)C(N)=O)cc2)cn1
Standard InChI: InChI=1S/C23H25N5O3/c1-15-6-4-5-7-19(15)28-14-18(13-26-28)20(29)25-12-16-8-10-17(11-9-16)21(30)27-23(2,3)22(24)31/h4-11,13-14H,12H2,1-3H3,(H2,24,31)(H,25,29)(H,27,30)
Standard InChI Key: QJMVNOAJMZKRQT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
13.1498 -5.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7415 -4.8082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3286 -5.5181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1692 -3.5749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1681 -4.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8829 -4.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5994 -4.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5964 -3.5712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8811 -3.1622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3144 -4.8132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3157 -5.6382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.0283 -4.3996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4547 -3.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7403 -3.5753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0258 -3.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3114 -3.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0256 -2.3379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5564 -3.2404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0046 -3.8537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4173 -4.5681 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2241 -4.3962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1791 -3.8457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7751 -3.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9504 -3.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5300 -3.8279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9403 -4.5491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7637 -4.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1716 -5.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4546 -4.3934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1704 -4.8037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4519 -3.5685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 2 0
10 12 1 0
4 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 16 1 0
19 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
12 2 1 0
27 28 1 0
2 29 1 0
29 30 1 0
29 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.49Molecular Weight (Monoisotopic): 419.1957AlogP: 2.10#Rotatable Bonds: 7Polar Surface Area: 119.11Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.60CX LogP: 2.12CX LogD: 2.12Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.73
References 1. Röhm S, Berger BT, Schröder M, Chaikuad A, Winkel R, Hekking KFW, Benningshof JJC, Müller G, Tesch R, Kudolo M, Forster M, Laufer S, Knapp S.. (2019) Fast Iterative Synthetic Approach toward Identification of Novel Highly Selective p38 MAP Kinase Inhibitors., 62 (23): [PMID:31702918 ] [10.1021/acs.jmedchem.9b01227 ]