N-(4-((1-Amino-2-methyl-1-oxopropan-2-yl)carbamoyl)benzyl)-1-(o-tolyl)-1H-pyrazole-4-carboxamide

ID: ALA4474175

PubChem CID: 155536847

Max Phase: Preclinical

Molecular Formula: C23H25N5O3

Molecular Weight: 419.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccccc1-n1cc(C(=O)NCc2ccc(C(=O)NC(C)(C)C(N)=O)cc2)cn1

Standard InChI:  InChI=1S/C23H25N5O3/c1-15-6-4-5-7-19(15)28-14-18(13-26-28)20(29)25-12-16-8-10-17(11-9-16)21(30)27-23(2,3)22(24)31/h4-11,13-14H,12H2,1-3H3,(H2,24,31)(H,25,29)(H,27,30)

Standard InChI Key:  QJMVNOAJMZKRQT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   13.1498   -5.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7415   -4.8082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3286   -5.5181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1692   -3.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1681   -4.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8829   -4.8151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5994   -4.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5964   -3.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8811   -3.1622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3144   -4.8132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3157   -5.6382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0283   -4.3996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4547   -3.1626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7403   -3.5753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0258   -3.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3114   -3.5756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0256   -2.3379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5564   -3.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0046   -3.8537    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4173   -4.5681    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2241   -4.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1791   -3.8457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7751   -3.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9504   -3.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5300   -3.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9403   -4.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7637   -4.5538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1716   -5.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4546   -4.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1704   -4.8037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4519   -3.5685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  2  0
 10 12  1  0
  4 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 12  2  1  0
 27 28  1  0
  2 29  1  0
 29 30  1  0
 29 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4474175

    ---

Associated Targets(Human)

MAPK14 Tchem MAP kinase p38 alpha (12866 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPK11 Tchem MAP kinase p38 beta (2785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.49Molecular Weight (Monoisotopic): 419.1957AlogP: 2.10#Rotatable Bonds: 7
Polar Surface Area: 119.11Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.60CX LogP: 2.12CX LogD: 2.12
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -1.73

References

1. Röhm S, Berger BT, Schröder M, Chaikuad A, Winkel R, Hekking KFW, Benningshof JJC, Müller G, Tesch R, Kudolo M, Forster M, Laufer S, Knapp S..  (2019)  Fast Iterative Synthetic Approach toward Identification of Novel Highly Selective p38 MAP Kinase Inhibitors.,  62  (23): [PMID:31702918] [10.1021/acs.jmedchem.9b01227]

Source