Ethyl 1-(4-methylbenzyl)-1H-indole-2-carboxylate

ID: ALA4474194

PubChem CID: 155536959

Max Phase: Preclinical

Molecular Formula: C19H19NO2

Molecular Weight: 293.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cc2ccccc2n1Cc1ccc(C)cc1

Standard InChI:  InChI=1S/C19H19NO2/c1-3-22-19(21)18-12-16-6-4-5-7-17(16)20(18)13-15-10-8-14(2)9-11-15/h4-12H,3,13H2,1-2H3

Standard InChI Key:  HCTFJVURTSOPIG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   28.9443   -8.3164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4995   -9.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4984  -10.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2064  -10.5808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2046   -8.9434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9132   -9.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9135  -10.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6965  -10.4260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1802   -9.7599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6961   -9.0941    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9974   -9.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3943   -7.7120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6439   -6.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0947   -6.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2953   -6.5049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0481   -7.2883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5990   -7.8890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4062  -10.4671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4057   -9.0517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.2234  -10.4669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6323  -11.1744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7445   -5.9012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  6  1  0
  9 11  1  0
 10  1  1  0
  1 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 11 18  1  0
 11 19  2  0
 18 20  1  0
 20 21  1  0
 15 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474194

    ---

Associated Targets(Human)

NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 293.37Molecular Weight (Monoisotopic): 293.1416AlogP: 4.17#Rotatable Bonds: 4
Polar Surface Area: 31.23Molecular Species: HBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.68Np Likeness Score: -1.25

References

1. Keček Plešec K, Urbančič D, Gobec M, Pekošak A, Tomašič T, Anderluh M, Mlinarič-Raščan I, Jakopin Ž..  (2016)  Identification of indole scaffold-based dual inhibitors of NOD1 and NOD2.,  24  (21): [PMID:27601373] [10.1016/j.bmc.2016.08.044]

Source