The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-6-(2-chloro-3-fluorophenyl)-5-methyl-2-((3-methyl-4-(4-methylpiperazin-1-yl)phenyl)amino)-8-(1-propionylpiperidin-3-yl)pyrido[2,3-d]pyrimidin-7(8H)-one ID: ALA4474196
PubChem CID: 138911325
Max Phase: Preclinical
Molecular Formula: C34H39ClFN7O2
Molecular Weight: 632.18
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)N1CCC[C@@H](n2c(=O)c(-c3cccc(F)c3Cl)c(C)c3cnc(Nc4ccc(N5CCN(C)CC5)c(C)c4)nc32)C1
Standard InChI: InChI=1S/C34H39ClFN7O2/c1-5-29(44)42-13-7-8-24(20-42)43-32-26(22(3)30(33(43)45)25-9-6-10-27(36)31(25)35)19-37-34(39-32)38-23-11-12-28(21(2)18-23)41-16-14-40(4)15-17-41/h6,9-12,18-19,24H,5,7-8,13-17,20H2,1-4H3,(H,37,38,39)/t24-/m1/s1
Standard InChI Key: REZLHNFSSBBSFC-XMMPIXPASA-N
Molfile:
RDKit 2D
45 50 0 0 0 0 0 0 0 0999 V2000
38.3570 -5.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3559 -6.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0681 -6.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7819 -6.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7790 -5.6630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0663 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0684 -7.7198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.3547 -8.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3525 -8.9447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0625 -9.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7762 -8.9501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7800 -8.1262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0638 -4.4365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.7745 -4.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4813 -4.4346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.4714 -2.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7683 -3.2043 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1894 -3.1983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1913 -4.0181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9017 -4.4267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6106 -4.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6048 -3.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8938 -2.7887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6437 -6.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0592 -10.1828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9045 -5.2480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3246 -4.4214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.3134 -2.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0286 -3.1849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7368 -2.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.7312 -1.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0113 -1.5423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3060 -1.9619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1901 -5.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1910 -6.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9024 -6.8900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6147 -6.4760 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.6154 -5.6521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8884 -1.9674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3265 -6.8887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3266 -7.7100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.0383 -6.4759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.0384 -8.1185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5900 -1.5565 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
44.0023 -0.7210 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
7 12 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
3 7 1 0
6 13 1 0
13 14 1 0
14 15 2 0
15 19 1 0
18 16 1 0
16 17 2 0
17 14 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 18 1 0
2 24 1 0
10 25 1 0
26 20 1 1
21 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
22 28 1 0
26 34 1 0
26 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
23 39 1 0
37 40 1 0
40 41 1 0
40 42 2 0
41 43 1 0
33 44 1 0
32 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 632.18Molecular Weight (Monoisotopic): 631.2838AlogP: 5.94#Rotatable Bonds: 6Polar Surface Area: 86.60Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.86CX LogP: 5.85CX LogD: 5.25Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.28Np Likeness Score: -1.44
References 1. Shen J, Zhang T, Zhu SJ, Sun M, Tong L, Lai M, Zhang R, Xu W, Wu R, Ding J, Yun CH, Xie H, Lu X, Ding K.. (2019) Structure-Based Design of 5-Methylpyrimidopyridone Derivatives as New Wild-Type Sparing Inhibitors of the Epidermal Growth Factor Receptor Triple Mutant (EGFRL858R/T790M/C797S )., 62 (15): [PMID:31298540 ] [10.1021/acs.jmedchem.9b00576 ] 2. Shen J, Zhang T, Zhu SJ, Sun M, Tong L, Lai M, Zhang R, Xu W, Wu R, Ding J, Yun CH, Xie H, Lu X, Ding K.. (2019) Structure-Based Design of 5-Methylpyrimidopyridone Derivatives as New Wild-Type Sparing Inhibitors of the Epidermal Growth Factor Receptor Triple Mutant (EGFRL858R/T790M/C797S )., 62 (15): [PMID:31298540 ] [10.1021/acs.jmedchem.9b00576 ]