(R)-6-(2-chloro-3-fluorophenyl)-5-methyl-2-((3-methyl-4-(4-methylpiperazin-1-yl)phenyl)amino)-8-(1-propionylpiperidin-3-yl)pyrido[2,3-d]pyrimidin-7(8H)-one

ID: ALA4474196

PubChem CID: 138911325

Max Phase: Preclinical

Molecular Formula: C34H39ClFN7O2

Molecular Weight: 632.18

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCC(=O)N1CCC[C@@H](n2c(=O)c(-c3cccc(F)c3Cl)c(C)c3cnc(Nc4ccc(N5CCN(C)CC5)c(C)c4)nc32)C1

Standard InChI:  InChI=1S/C34H39ClFN7O2/c1-5-29(44)42-13-7-8-24(20-42)43-32-26(22(3)30(33(43)45)25-9-6-10-27(36)31(25)35)19-37-34(39-32)38-23-11-12-28(21(2)18-23)41-16-14-40(4)15-17-41/h6,9-12,18-19,24H,5,7-8,13-17,20H2,1-4H3,(H,37,38,39)/t24-/m1/s1

Standard InChI Key:  REZLHNFSSBBSFC-XMMPIXPASA-N

Molfile:  

 
     RDKit          2D

 45 50  0  0  0  0  0  0  0  0999 V2000
   38.3570   -5.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3559   -6.4903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0681   -6.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7819   -6.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7790   -5.6630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0663   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0684   -7.7198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.3547   -8.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3525   -8.9447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0625   -9.3615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7762   -8.9501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7800   -8.1262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0638   -4.4365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7745   -4.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4813   -4.4346    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.4714   -2.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7683   -3.2043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1894   -3.1983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1913   -4.0181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9017   -4.4267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.6106   -4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6048   -3.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8938   -2.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6437   -6.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0592  -10.1828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9045   -5.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3246   -4.4214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.3134   -2.7799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0286   -3.1849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7368   -2.7717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.7312   -1.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0113   -1.5423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3060   -1.9619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1901   -5.6581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1910   -6.4759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9024   -6.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6147   -6.4760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.6154   -5.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8884   -1.9674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3265   -6.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3266   -7.7100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0383   -6.4759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.0384   -8.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5900   -1.5565    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   44.0023   -0.7210    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  1  0
  7 12  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3  7  1  0
  6 13  1  0
 13 14  1  0
 14 15  2  0
 15 19  1  0
 18 16  1  0
 16 17  2  0
 17 14  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  2 24  1  0
 10 25  1  0
 26 20  1  1
 21 27  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 22 28  1  0
 26 34  1  0
 26 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 23 39  1  0
 37 40  1  0
 40 41  1  0
 40 42  2  0
 41 43  1  0
 33 44  1  0
 32 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474196

    ---

Associated Targets(Human)

EGFR Tclin Epidermal growth factor receptor erbB1 (33727 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

BaF3 (4657 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 632.18Molecular Weight (Monoisotopic): 631.2838AlogP: 5.94#Rotatable Bonds: 6
Polar Surface Area: 86.60Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.86CX LogP: 5.85CX LogD: 5.25
Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.28Np Likeness Score: -1.44

References

1. Shen J, Zhang T, Zhu SJ, Sun M, Tong L, Lai M, Zhang R, Xu W, Wu R, Ding J, Yun CH, Xie H, Lu X, Ding K..  (2019)  Structure-Based Design of 5-Methylpyrimidopyridone Derivatives as New Wild-Type Sparing Inhibitors of the Epidermal Growth Factor Receptor Triple Mutant (EGFRL858R/T790M/C797S).,  62  (15): [PMID:31298540] [10.1021/acs.jmedchem.9b00576]
2. Shen J, Zhang T, Zhu SJ, Sun M, Tong L, Lai M, Zhang R, Xu W, Wu R, Ding J, Yun CH, Xie H, Lu X, Ding K..  (2019)  Structure-Based Design of 5-Methylpyrimidopyridone Derivatives as New Wild-Type Sparing Inhibitors of the Epidermal Growth Factor Receptor Triple Mutant (EGFRL858R/T790M/C797S).,  62  (15): [PMID:31298540] [10.1021/acs.jmedchem.9b00576]

Source