The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((2-(6-Methoxy-2-phenylquinolin-4-yl)hydrazono)methyl)-N,N-dimethylaniline ID: ALA4474281
PubChem CID: 155536913
Max Phase: Preclinical
Molecular Formula: C25H24N4O
Molecular Weight: 396.49
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2nc(-c3ccccc3)cc(N/N=C/c3ccc(N(C)C)cc3)c2c1
Standard InChI: InChI=1S/C25H24N4O/c1-29(2)20-11-9-18(10-12-20)17-26-28-25-16-24(19-7-5-4-6-8-19)27-23-14-13-21(30-3)15-22(23)25/h4-17H,1-3H3,(H,27,28)/b26-17+
Standard InChI Key: JPPUEKXVIAFKFT-YZSQISJMSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
25.3150 -21.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3139 -22.1779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0219 -22.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0201 -20.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7287 -21.3548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7295 -22.1738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4380 -22.5808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1463 -22.1700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1416 -21.3479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4324 -20.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8556 -22.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4281 -20.1274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1336 -19.7150 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.6072 -20.9499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.6070 -20.1328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8435 -20.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5490 -19.7075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2574 -20.1172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9624 -19.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9585 -18.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2437 -18.4828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5416 -18.8968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8539 -23.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5623 -23.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2694 -23.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2636 -22.5631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5546 -22.1610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6635 -18.4742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3739 -18.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6581 -17.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 1 0
10 12 1 0
12 13 1 0
1 14 1 0
14 15 1 0
13 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 11 1 0
20 28 1 0
28 29 1 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.49Molecular Weight (Monoisotopic): 396.1950AlogP: 5.42#Rotatable Bonds: 6Polar Surface Area: 49.75Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.00CX LogP: 5.94CX LogD: 5.73Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -1.31
References 1. Hussein B, Ikhmais B, Kadirvel M, Magwaza RN, Halbert G, Bryce RA, Stratford IJ, Freeman S.. (2019) Discovery of potent 4-aminoquinoline hydrazone inhibitors of NRH:quinoneoxidoreductase-2 (NQO2)., 182 [PMID:31514018 ] [10.1016/j.ejmech.2019.111649 ]