4-((2-(6-Methoxy-2-phenylquinolin-4-yl)hydrazono)methyl)-N,N-dimethylaniline

ID: ALA4474281

PubChem CID: 155536913

Max Phase: Preclinical

Molecular Formula: C25H24N4O

Molecular Weight: 396.49

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2nc(-c3ccccc3)cc(N/N=C/c3ccc(N(C)C)cc3)c2c1

Standard InChI:  InChI=1S/C25H24N4O/c1-29(2)20-11-9-18(10-12-20)17-26-28-25-16-24(19-7-5-4-6-8-19)27-23-14-13-21(30-3)15-22(23)25/h4-17H,1-3H3,(H,27,28)/b26-17+

Standard InChI Key:  JPPUEKXVIAFKFT-YZSQISJMSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   25.3150  -21.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3139  -22.1779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0219  -22.5869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0201  -20.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7287  -21.3548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7295  -22.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4380  -22.5808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1463  -22.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1416  -21.3479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4324  -20.9445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8556  -22.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4281  -20.1274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1336  -19.7150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6072  -20.9499    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.6070  -20.1328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8435  -20.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5490  -19.7075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2574  -20.1172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9624  -19.7055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9585  -18.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2437  -18.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5416  -18.8968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8539  -23.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5623  -23.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2694  -23.3845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2636  -22.5631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5546  -22.1610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6635  -18.4742    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.3739  -18.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6581  -17.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  8 11  1  0
 10 12  1  0
 12 13  1  0
  1 14  1  0
 14 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 11 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 11  1  0
 20 28  1  0
 28 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4474281

    ---

Associated Targets(Human)

SK-OV-3 (52876 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NQO2 Tchem Quinone reductase 2 (885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.49Molecular Weight (Monoisotopic): 396.1950AlogP: 5.42#Rotatable Bonds: 6
Polar Surface Area: 49.75Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.00CX LogP: 5.94CX LogD: 5.73
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: -1.31

References

1. Hussein B, Ikhmais B, Kadirvel M, Magwaza RN, Halbert G, Bryce RA, Stratford IJ, Freeman S..  (2019)  Discovery of potent 4-aminoquinoline hydrazone inhibitors of NRH:quinoneoxidoreductase-2 (NQO2).,  182  [PMID:31514018] [10.1016/j.ejmech.2019.111649]

Source