The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2-hydroxynicotinamido)phenyl ethyl(methyl)carbamate ID: ALA4474289
PubChem CID: 155536974
Max Phase: Preclinical
Molecular Formula: C16H17N3O4
Molecular Weight: 315.33
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(C)C(=O)Oc1cccc(NC(=O)c2cccnc2O)c1
Standard InChI: InChI=1S/C16H17N3O4/c1-3-19(2)16(22)23-12-7-4-6-11(10-12)18-15(21)13-8-5-9-17-14(13)20/h4-10H,3H2,1-2H3,(H,17,20)(H,18,21)
Standard InChI Key: UBUZMHINYCRSKO-UHFFFAOYSA-N
Molfile:
RDKit 2D
23 24 0 0 0 0 0 0 0 0999 V2000
4.9389 -3.3141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9377 -4.1337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6458 -4.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3554 -4.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3526 -3.3105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6440 -2.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2311 -2.9057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5235 -3.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8157 -2.9060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5237 -4.1317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8155 -2.0888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1080 -3.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4002 -2.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0588 -2.8993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7680 -3.3052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4742 -2.8939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7711 -4.1224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1818 -3.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8875 -2.8927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8849 -2.0746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1707 -1.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4679 -2.0818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1829 -4.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
7 8 1 0
8 9 1 0
8 10 2 0
9 11 1 0
9 12 1 0
12 13 1 0
5 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
16 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 16 1 0
18 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 315.33Molecular Weight (Monoisotopic): 315.1219AlogP: 2.49#Rotatable Bonds: 4Polar Surface Area: 91.76Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.77CX Basic pKa: 2.06CX LogP: 2.22CX LogD: 2.21Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.90Np Likeness Score: -1.59
References 1. Sestito S, Wang S, Chen Q, Lu J, Bertini S, Pomelli C, Chiellini G, He X, Pi R, Rapposelli S.. (2019) Multi-targeted ChEI-copper chelating molecules as neuroprotective agents., 174 [PMID:31042617 ] [10.1016/j.ejmech.2019.04.060 ]