The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(4-((1-(4-methoxyphenyl)-1H-1,2,3-triazol-4-yl)methoxy)benzylidene)-2-thioxothiazolidin-4-one ID: ALA4474290
PubChem CID: 155536975
Max Phase: Preclinical
Molecular Formula: C20H16N4O3S2
Molecular Weight: 424.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2cc(COc3ccc(/C=C4\SC(=S)NC4=O)cc3)nn2)cc1
Standard InChI: InChI=1S/C20H16N4O3S2/c1-26-16-8-4-15(5-9-16)24-11-14(22-23-24)12-27-17-6-2-13(3-7-17)10-18-19(25)21-20(28)29-18/h2-11H,12H2,1H3,(H,21,25,28)/b18-10-
Standard InChI Key: BXOFFZDMKRHPKI-ZDLGFXPLSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
25.2642 -28.5429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8572 -27.8344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0408 -27.8340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6314 -28.5422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0443 -29.2523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8594 -29.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0078 -24.8339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0037 -25.6511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.7796 -25.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2633 -25.2489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7863 -24.5854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1793 -24.8418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1782 -25.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8862 -26.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5959 -25.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5930 -24.8382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8844 -24.4329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2992 -24.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0282 -26.6861 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
32.0427 -23.8095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4701 -26.0693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.7627 -25.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0469 -26.8848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0586 -26.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2852 -25.8042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7954 -26.4583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.2659 -27.1267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6382 -29.9614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8210 -29.9643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
16 18 1 0
18 7 2 0
9 19 2 0
11 20 2 0
13 21 1 0
21 22 1 0
22 24 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 23 1 0
27 2 1 0
5 28 1 0
28 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.51Molecular Weight (Monoisotopic): 424.0664AlogP: 3.34#Rotatable Bonds: 6Polar Surface Area: 78.27Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.93CX Basic pKa: ┄CX LogP: 3.94CX LogD: 2.10Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -1.89
References 1. Elzahhar PA, Alaaeddine R, Ibrahim TM, Nassra R, Ismail A, Chua BSK, Frkic RL, Bruning JB, Wallner N, Knape T, von Knethen A, Labib H, El-Yazbi AF, Belal ASF.. (2019) Shooting three inflammatory targets with a single bullet: Novel multi-targeting anti-inflammatory glitazones., 167 [PMID:30818268 ] [10.1016/j.ejmech.2019.02.034 ]