The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-([1,1'-biphenyl]-4-ylmethyl)-7-((2-aminoethyl)amino)-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid ID: ALA4474303
PubChem CID: 134603904
Max Phase: Preclinical
Molecular Formula: C25H22FN3O3
Molecular Weight: 431.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NCCNc1cc2c(cc1F)c(=O)c(C(=O)O)cn2Cc1ccc(-c2ccccc2)cc1
Standard InChI: InChI=1S/C25H22FN3O3/c26-21-12-19-23(13-22(21)28-11-10-27)29(15-20(24(19)30)25(31)32)14-16-6-8-18(9-7-16)17-4-2-1-3-5-17/h1-9,12-13,15,28H,10-11,14,27H2,(H,31,32)
Standard InChI Key: IEWWOOFEECNLNI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
5.7189 -9.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7178 -10.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4258 -10.8119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4240 -9.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1327 -9.5798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1315 -10.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8377 -10.8095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5496 -10.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5507 -9.5818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8400 -9.1682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8400 -8.3510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2594 -9.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9661 -9.5852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2614 -8.3577 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8354 -11.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5420 -12.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5383 -12.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2441 -13.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9539 -12.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9536 -12.0357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2472 -11.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6592 -13.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6567 -14.0832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3630 -14.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0722 -14.0851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0708 -13.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3640 -12.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0111 -9.1750 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0097 -10.8110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3024 -10.4018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5943 -10.8098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8869 -10.4007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
9 12 1 0
12 13 1 0
12 14 2 0
7 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
19 22 1 0
1 28 1 0
2 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.47Molecular Weight (Monoisotopic): 431.1645AlogP: 3.92#Rotatable Bonds: 7Polar Surface Area: 97.35Molecular Species: ZWITTERIONHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.83CX Basic pKa: 9.42CX LogP: 1.30CX LogD: 1.31Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.41Np Likeness Score: -0.97
References 1. Delgado JL, Lentz SRC, Kulkarni CA, Chheda PR, Held HA, Hiasa H, Kerns RJ.. (2019) Probing structural requirements for human topoisomerase I inhibition by a novel N1-Biphenyl fluoroquinolone., 172 [PMID:30959322 ] [10.1016/j.ejmech.2019.03.040 ]