The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((3-(3-fluoro-4-(4-(4-isopropylphenylamino)piperidin-1-yl)phenyl)-2-oxooxazolidin-5-yl)methyl)acetamide ID: ALA4474315
PubChem CID: 155536919
Max Phase: Preclinical
Molecular Formula: C26H33FN4O3
Molecular Weight: 468.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)NC[C@H]1CN(c2ccc(N3CCC(Nc4ccc(C(C)C)cc4)CC3)c(F)c2)C(=O)O1
Standard InChI: InChI=1S/C26H33FN4O3/c1-17(2)19-4-6-20(7-5-19)29-21-10-12-30(13-11-21)25-9-8-22(14-24(25)27)31-16-23(34-26(31)33)15-28-18(3)32/h4-9,14,17,21,23,29H,10-13,15-16H2,1-3H3,(H,28,32)/t23-/m0/s1
Standard InChI Key: ZYSDJZUQNCAMPG-QHCPKHFHSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
4.7298 -10.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7298 -11.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4351 -12.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1404 -11.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1404 -10.7968 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4351 -10.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0227 -12.0236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0239 -12.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3154 -13.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3163 -14.0647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0251 -14.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7346 -14.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7302 -13.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8456 -10.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5524 -10.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2608 -10.3989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2637 -9.5808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5522 -9.1703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8467 -9.5785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9720 -9.1734 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7138 -9.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2616 -8.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8541 -8.1920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0545 -8.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4466 -7.8145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0741 -8.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5555 -8.3267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3681 -8.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8495 -7.7531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6993 -9.1605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1390 -9.1698 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.0274 -15.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3208 -15.7008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7362 -15.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
2 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
5 14 1 0
17 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
24 25 2 0
22 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
28 30 2 0
19 31 1 0
11 32 1 0
32 33 1 0
32 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.57Molecular Weight (Monoisotopic): 468.2537AlogP: 4.49#Rotatable Bonds: 7Polar Surface Area: 73.91Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.31CX LogP: 3.38CX LogD: 3.38Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.63Np Likeness Score: -1.47
References 1. Hou Y, Dong Y, Ye T, Jiang J, Ding L, Qin M, Ding X, Zhao Y.. (2019) Synthesis and antibacterial evaluation of novel oxazolidinone derivatives containing a piperidinyl moiety., 29 (23): [PMID:31676225 ] [10.1016/j.bmcl.2019.126746 ]