The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((4-(3-(10H-phenothiazin-10-yl)propyl)piperazin-1-yl)methyl)-5,7-dihydroxy-2-phenylchroman-4-one ID: ALA4474323
PubChem CID: 155536952
Max Phase: Preclinical
Molecular Formula: C35H35N3O4S
Molecular Weight: 593.75
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CC(c2ccccc2)Oc2cc(O)c(CN3CCN(CCCN4c5ccccc5Sc5ccccc54)CC3)c(O)c21
Standard InChI: InChI=1S/C35H35N3O4S/c39-28-21-31-34(29(40)22-30(42-31)24-9-2-1-3-10-24)35(41)25(28)23-37-19-17-36(18-20-37)15-8-16-38-26-11-4-6-13-32(26)43-33-14-7-5-12-27(33)38/h1-7,9-14,21,30,39,41H,8,15-20,22-23H2
Standard InChI Key: XKJZOZBZQUPVRT-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 49 0 0 0 0 0 0 0 0999 V2000
4.1261 -19.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8437 -18.8439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5571 -19.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5571 -20.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8437 -20.4952 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.1261 -20.0803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4154 -20.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7016 -20.0780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6989 -19.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4081 -18.8416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2751 -20.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9842 -20.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9817 -19.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2678 -18.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8437 -18.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5568 -17.6039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5568 -16.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2699 -16.3679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2699 -15.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9830 -15.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7003 -15.5427 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7003 -16.3680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9830 -16.7827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4134 -15.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1266 -15.5427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8442 -15.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5536 -15.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5536 -16.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8467 -16.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1266 -16.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4134 -16.7836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2671 -16.7827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9846 -16.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9846 -15.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2671 -15.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2671 -14.3061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6978 -16.7825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4112 -16.3681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1248 -16.7820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1248 -17.6035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4137 -18.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6978 -17.6088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8442 -14.3071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 1 0
1 6 2 0
6 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
1 10 1 0
4 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
3 14 1 0
2 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
23 22 1 0
18 23 1 0
21 24 1 0
24 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
25 30 1 0
30 31 1 0
28 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
27 35 1 0
35 36 2 0
37 33 1 0
38 37 2 0
39 38 1 0
40 39 2 0
41 40 1 0
42 41 2 0
37 42 1 0
26 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 593.75Molecular Weight (Monoisotopic): 593.2348AlogP: 6.61#Rotatable Bonds: 7Polar Surface Area: 76.48Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.63CX Basic pKa: 7.61CX LogP: 5.92CX LogD: 5.89Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.25Np Likeness Score: 0.06
References 1. Gao Y, Sun TY, Bai WF, Bai CG.. (2019) Design, synthesis and evaluation of novel phenothiazine derivatives as inhibitors of breast cancer stem cells., 183 [PMID:31541872 ] [10.1016/j.ejmech.2019.111692 ]