The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
rac-4-(3-((4-((S)-cyano((1S,2R)-2-methoxycyclopentyl)(phenyl)methyl)piperidin-1-yl)methyl)azetidin-1-yl)benzonitrile ID: ALA4474336
PubChem CID: 155536984
Max Phase: Preclinical
Molecular Formula: C30H36N4O
Molecular Weight: 468.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H]1CCC[C@H]1[C@](C#N)(c1ccccc1)C1CCN(CC2CN(c3ccc(C#N)cc3)C2)CC1
Standard InChI: InChI=1S/C30H36N4O/c1-35-29-9-5-8-28(29)30(22-32,25-6-3-2-4-7-25)26-14-16-33(17-15-26)19-24-20-34(21-24)27-12-10-23(18-31)11-13-27/h2-4,6-7,10-13,24,26,28-29H,5,8-9,14-17,19-21H2,1H3/t28-,29-,30-/m1/s1
Standard InChI Key: XWVPFMAEIFLCFQ-IDZRBWSNSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
37.9402 -5.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9390 -5.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6471 -6.2513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3568 -5.8419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3539 -5.0192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6453 -4.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6429 -3.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9339 -3.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9341 -2.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2292 -2.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5203 -2.5749 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5208 -3.3931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2302 -3.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3494 -3.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0972 -3.7143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6422 -3.1054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2315 -2.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4327 -2.5712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6350 -2.9757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8130 -2.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1049 -2.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3149 -2.3582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1028 -3.1474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8920 -3.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3978 -3.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6901 -3.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9826 -3.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9815 -4.3685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6938 -4.7775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3985 -4.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2732 -4.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5657 -5.1897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.6271 -2.1547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.2705 -4.5129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0487 -4.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3449 -4.2015 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 6
8 9 1 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
7 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 14 1 0
7 19 1 0
11 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 21 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
23 25 1 0
31 32 3 0
28 31 1 0
19 33 3 0
15 34 1 1
34 35 1 0
14 36 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.65Molecular Weight (Monoisotopic): 468.2889AlogP: 4.98#Rotatable Bonds: 7Polar Surface Area: 63.29Molecular Species: BASEHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.24CX LogP: 4.88CX LogD: 3.05Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -0.89
References 1. Aguilar A, Zheng K, Xu T, Xu S, Huang L, Fernandez-Salas E, Liu L, Bernard D, Harvey KP, Foster C, McEachern D, Stuckey J, Chinnaswamy K, Delproposto J, Kampf JW, Wang S.. (2019) Structure-Based Discovery of M-89 as a Highly Potent Inhibitor of the Menin-Mixed Lineage Leukemia (Menin-MLL) Protein-Protein Interaction., 62 (13): [PMID:31244110 ] [10.1021/acs.jmedchem.9b00021 ]