The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-aminophenyl)-4-(((7-methoxy-3-methyl-4-oxo-3,4-dihydroquinazolin-2-yl)thio)methyl)benzamide ID: ALA4474354
PubChem CID: 155537008
Max Phase: Preclinical
Molecular Formula: C24H22N4O3S
Molecular Weight: 446.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(=O)n(C)c(SCc3ccc(C(=O)Nc4ccccc4N)cc3)nc2c1
Standard InChI: InChI=1S/C24H22N4O3S/c1-28-23(30)18-12-11-17(31-2)13-21(18)27-24(28)32-14-15-7-9-16(10-8-15)22(29)26-20-6-4-3-5-19(20)25/h3-13H,14,25H2,1-2H3,(H,26,29)
Standard InChI Key: XENPZBJDQVYEKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
16.2640 -14.7878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2628 -15.6074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9709 -16.0163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9691 -14.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6777 -14.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6811 -15.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3895 -16.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0992 -15.5991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0958 -14.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3828 -14.3687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3918 -16.8272 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8022 -14.3676 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.5112 -14.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2177 -14.3633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9260 -14.7720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6319 -14.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6298 -13.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9159 -13.1376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2129 -13.5500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3357 -13.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0452 -13.5375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3321 -12.3149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.7511 -13.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4591 -13.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1645 -13.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1613 -12.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4468 -11.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7443 -12.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4611 -14.3509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.8080 -16.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5562 -14.3794 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8486 -14.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
24 29 1 0
8 30 1 0
1 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.53Molecular Weight (Monoisotopic): 446.1413AlogP: 4.07#Rotatable Bonds: 6Polar Surface Area: 99.24Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.51CX LogP: 4.10CX LogD: 4.10Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.26Np Likeness Score: -1.53
References 1. Cheng C, Yun F, He J, Ullah S, Yuan Q.. (2019) Design, synthesis and biological evaluation of novel thioquinazolinone-based 2-aminobenzamide derivatives as potent histone deacetylase (HDAC) inhibitors., 173 [PMID:31003060 ] [10.1016/j.ejmech.2019.04.017 ]