The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N'-{6-chloro-2-[(E)-2-(3,4-difluorophenyl)ethenyl]quinazolin-4-yl}-N,N-diethylpropane-1,3-diamine ID: ALA4474389
PubChem CID: 121453117
Max Phase: Preclinical
Molecular Formula: C23H25ClF2N4
Molecular Weight: 430.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCNc1nc(/C=C/c2ccc(F)c(F)c2)nc2ccc(Cl)cc12
Standard InChI: InChI=1S/C23H25ClF2N4/c1-3-30(4-2)13-5-12-27-23-18-15-17(24)8-10-21(18)28-22(29-23)11-7-16-6-9-19(25)20(26)14-16/h6-11,14-15H,3-5,12-13H2,1-2H3,(H,27,28,29)/b11-7+
Standard InChI Key: HMZRQPIDURBHOJ-YRNVUSSQSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
30.2925 -19.9818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5823 -19.5775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8771 -19.9904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1680 -19.5870 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.4643 -19.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4651 -20.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7575 -21.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0494 -20.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0506 -20.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7557 -19.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1736 -21.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8819 -20.8125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1753 -22.0405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.8838 -22.4477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5907 -22.0376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2993 -22.4447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0061 -22.0347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.7147 -22.4418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0044 -21.2175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9977 -19.5689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7049 -19.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4096 -19.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4051 -18.7469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6899 -18.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9881 -18.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3414 -21.2284 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
33.1097 -18.3331 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.6821 -17.5257 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
31.7113 -20.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4215 -22.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
3 4 2 0
4 5 1 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
5 10 2 0
6 11 1 0
11 12 2 0
12 3 1 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
17 19 1 0
1 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
8 26 1 0
23 27 1 0
24 28 1 0
19 29 1 0
18 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.93Molecular Weight (Monoisotopic): 430.1736AlogP: 5.88#Rotatable Bonds: 9Polar Surface Area: 41.05Molecular Species: BASEHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.94CX LogP: 6.36CX LogD: 3.85Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -1.56
References 1. Baska F, Sipos A, Őrfi Z, Nemes Z, Dobos J, Szántai-Kis C, Szabó E, Szénási G, Dézsi L, Hamar P, Cserepes MT, Tóvári J, Garamvölgyi R, Krekó M, Őrfi L.. (2019) Discovery and development of extreme selective inhibitors of the ITD and D835Y mutant FLT3 kinases., 184 [PMID:31614258 ] [10.1016/j.ejmech.2019.111710 ]