The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-Methyl-2-(4-(6-(piperidin-1-yl)hexyloxy)phenyl)-4H-chromen-4-one ID: ALA4474399
PubChem CID: 155536937
Max Phase: Preclinical
Molecular Formula: C27H33NO3
Molecular Weight: 419.57
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2oc(-c3ccc(OCCCCCCN4CCCCC4)cc3)cc(=O)c2c1
Standard InChI: InChI=1S/C27H33NO3/c1-21-9-14-26-24(19-21)25(29)20-27(31-26)22-10-12-23(13-11-22)30-18-8-3-2-5-15-28-16-6-4-7-17-28/h9-14,19-20H,2-8,15-18H2,1H3
Standard InChI Key: NDDYCWJCTGXGIS-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
10.8114 -21.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8102 -22.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5183 -22.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2281 -22.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2292 -21.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5165 -20.9510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9373 -22.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9365 -23.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6449 -23.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3548 -23.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3593 -22.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6465 -22.1736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0658 -22.1822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7725 -22.5920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7719 -23.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0609 -23.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4786 -23.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6455 -24.6395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0994 -20.9515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3877 -21.3602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6758 -20.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9640 -21.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2521 -20.9522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5404 -21.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8284 -20.9525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1208 -21.3613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4114 -20.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7018 -21.3571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6978 -22.1787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4096 -22.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1254 -22.1824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 4 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
11 10 2 0
11 12 1 0
7 12 1 0
13 11 1 0
14 13 2 0
15 14 1 0
16 15 2 0
10 16 1 0
15 17 1 0
9 18 2 0
1 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
26 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2460AlogP: 6.19#Rotatable Bonds: 9Polar Surface Area: 42.68Molecular Species: BASEHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.99CX LogP: 5.66CX LogD: 3.12Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: -0.42
References 1. Bajda M, Łażewska D, Godyń J, Zaręba P, Kuder K, Hagenow S, Łątka K, Stawarska E, Stark H, Kieć-Kononowicz K, Malawska B.. (2020) Search for new multi-target compounds against Alzheimer's disease among histamine H3 receptor ligands., 185 [PMID:31669851 ] [10.1016/j.ejmech.2019.111785 ]